iOS
2 years ago
parent
542fe9c694
commit
5356323211
File diff suppressed because one or more lines are too long
@ -1,642 +0,0 @@
|
||||
/*
|
||||
THIS IS A GENERATED/BUNDLED FILE BY ESBUILD
|
||||
if you want to view the source, please visit the github repository of this plugin
|
||||
*/
|
||||
|
||||
var __create = Object.create;
|
||||
var __defProp = Object.defineProperty;
|
||||
var __getOwnPropDesc = Object.getOwnPropertyDescriptor;
|
||||
var __getOwnPropNames = Object.getOwnPropertyNames;
|
||||
var __getProtoOf = Object.getPrototypeOf;
|
||||
var __hasOwnProp = Object.prototype.hasOwnProperty;
|
||||
var __markAsModule = (target) => __defProp(target, "__esModule", { value: true });
|
||||
var __commonJS = (cb, mod) => function __require() {
|
||||
return mod || (0, cb[Object.keys(cb)[0]])((mod = { exports: {} }).exports, mod), mod.exports;
|
||||
};
|
||||
var __export = (target, all) => {
|
||||
__markAsModule(target);
|
||||
for (var name in all)
|
||||
__defProp(target, name, { get: all[name], enumerable: true });
|
||||
};
|
||||
var __reExport = (target, module2, desc) => {
|
||||
if (module2 && typeof module2 === "object" || typeof module2 === "function") {
|
||||
for (let key of __getOwnPropNames(module2))
|
||||
if (!__hasOwnProp.call(target, key) && key !== "default")
|
||||
__defProp(target, key, { get: () => module2[key], enumerable: !(desc = __getOwnPropDesc(module2, key)) || desc.enumerable });
|
||||
}
|
||||
return target;
|
||||
};
|
||||
var __toModule = (module2) => {
|
||||
return __reExport(__markAsModule(__defProp(module2 != null ? __create(__getProtoOf(module2)) : {}, "default", module2 && module2.__esModule && "default" in module2 ? { get: () => module2.default, enumerable: true } : { value: module2, enumerable: true })), module2);
|
||||
};
|
||||
var __async = (__this, __arguments, generator) => {
|
||||
return new Promise((resolve, reject) => {
|
||||
var fulfilled = (value) => {
|
||||
try {
|
||||
step(generator.next(value));
|
||||
} catch (e) {
|
||||
reject(e);
|
||||
}
|
||||
};
|
||||
var rejected = (value) => {
|
||||
try {
|
||||
step(generator.throw(value));
|
||||
} catch (e) {
|
||||
reject(e);
|
||||
}
|
||||
};
|
||||
var step = (x) => x.done ? resolve(x.value) : Promise.resolve(x.value).then(fulfilled, rejected);
|
||||
step((generator = generator.apply(__this, __arguments)).next());
|
||||
});
|
||||
};
|
||||
|
||||
// node_modules/node-webvtt/lib/parser.js
|
||||
var require_parser = __commonJS({
|
||||
"node_modules/node-webvtt/lib/parser.js"(exports, module2) {
|
||||
"use strict";
|
||||
function ParserError(message, error) {
|
||||
this.message = message;
|
||||
this.error = error;
|
||||
}
|
||||
ParserError.prototype = Object.create(Error.prototype);
|
||||
var TIMESTAMP_REGEXP = /([0-9]{1,2})?:?([0-9]{2}):([0-9]{2}\.[0-9]{2,3})/;
|
||||
function parse2(input, options) {
|
||||
if (!options) {
|
||||
options = {};
|
||||
}
|
||||
const { meta = false, strict = true } = options;
|
||||
if (typeof input !== "string") {
|
||||
throw new ParserError("Input must be a string");
|
||||
}
|
||||
input = input.trim();
|
||||
input = input.replace(/\r\n/g, "\n");
|
||||
input = input.replace(/\r/g, "\n");
|
||||
const parts = input.split("\n\n");
|
||||
const header = parts.shift();
|
||||
if (!header.startsWith("WEBVTT")) {
|
||||
throw new ParserError('Must start with "WEBVTT"');
|
||||
}
|
||||
const headerParts = header.split("\n");
|
||||
const headerComments = headerParts[0].replace("WEBVTT", "");
|
||||
if (headerComments.length > 0 && (headerComments[0] !== " " && headerComments[0] !== " ")) {
|
||||
throw new ParserError("Header comment must start with space or tab");
|
||||
}
|
||||
if (parts.length === 0 && headerParts.length === 1) {
|
||||
return { valid: true, strict, cues: [], errors: [] };
|
||||
}
|
||||
if (!meta && headerParts.length > 1 && headerParts[1] !== "") {
|
||||
throw new ParserError("Missing blank line after signature");
|
||||
}
|
||||
const { cues, errors } = parseCues(parts, strict);
|
||||
if (strict && errors.length > 0) {
|
||||
throw errors[0];
|
||||
}
|
||||
const headerMeta = meta ? parseMeta(headerParts) : null;
|
||||
const result = { valid: errors.length === 0, strict, cues, errors };
|
||||
if (meta) {
|
||||
result.meta = headerMeta;
|
||||
}
|
||||
return result;
|
||||
}
|
||||
function parseMeta(headerParts) {
|
||||
const meta = {};
|
||||
headerParts.slice(1).forEach((header) => {
|
||||
const splitIdx = header.indexOf(":");
|
||||
const key = header.slice(0, splitIdx).trim();
|
||||
const value = header.slice(splitIdx + 1).trim();
|
||||
meta[key] = value;
|
||||
});
|
||||
return Object.keys(meta).length > 0 ? meta : null;
|
||||
}
|
||||
function parseCues(cues, strict) {
|
||||
const errors = [];
|
||||
const parsedCues = cues.map((cue, i) => {
|
||||
try {
|
||||
return parseCue(cue, i, strict);
|
||||
} catch (e) {
|
||||
errors.push(e);
|
||||
return null;
|
||||
}
|
||||
}).filter(Boolean);
|
||||
return {
|
||||
cues: parsedCues,
|
||||
errors
|
||||
};
|
||||
}
|
||||
function parseCue(cue, i, strict) {
|
||||
let identifier = "";
|
||||
let start = 0;
|
||||
let end = 0.01;
|
||||
let text = "";
|
||||
let styles = "";
|
||||
const lines = cue.split("\n").filter(Boolean);
|
||||
if (lines.length > 0 && lines[0].trim().startsWith("NOTE")) {
|
||||
return null;
|
||||
}
|
||||
if (lines.length === 1 && !lines[0].includes("-->")) {
|
||||
throw new ParserError(`Cue identifier cannot be standalone (cue #${i})`);
|
||||
}
|
||||
if (lines.length > 1 && !(lines[0].includes("-->") || lines[1].includes("-->"))) {
|
||||
const msg = `Cue identifier needs to be followed by timestamp (cue #${i})`;
|
||||
throw new ParserError(msg);
|
||||
}
|
||||
if (lines.length > 1 && lines[1].includes("-->")) {
|
||||
identifier = lines.shift();
|
||||
}
|
||||
const times = typeof lines[0] === "string" && lines[0].split(" --> ");
|
||||
if (times.length !== 2 || !validTimestamp(times[0]) || !validTimestamp(times[1])) {
|
||||
throw new ParserError(`Invalid cue timestamp (cue #${i})`);
|
||||
}
|
||||
start = parseTimestamp(times[0]);
|
||||
end = parseTimestamp(times[1]);
|
||||
if (strict) {
|
||||
if (start > end) {
|
||||
throw new ParserError(`Start timestamp greater than end (cue #${i})`);
|
||||
}
|
||||
if (end <= start) {
|
||||
throw new ParserError(`End must be greater than start (cue #${i})`);
|
||||
}
|
||||
}
|
||||
if (!strict && end < start) {
|
||||
throw new ParserError(`End must be greater or equal to start when not strict (cue #${i})`);
|
||||
}
|
||||
styles = times[1].replace(TIMESTAMP_REGEXP, "").trim();
|
||||
lines.shift();
|
||||
text = lines.join("\n");
|
||||
if (!text) {
|
||||
return false;
|
||||
}
|
||||
return { identifier, start, end, text, styles };
|
||||
}
|
||||
function validTimestamp(timestamp) {
|
||||
return TIMESTAMP_REGEXP.test(timestamp);
|
||||
}
|
||||
function parseTimestamp(timestamp) {
|
||||
const matches = timestamp.match(TIMESTAMP_REGEXP);
|
||||
let secs = parseFloat(matches[1] || 0) * 60 * 60;
|
||||
secs += parseFloat(matches[2]) * 60;
|
||||
secs += parseFloat(matches[3]);
|
||||
return secs;
|
||||
}
|
||||
module2.exports = { ParserError, parse: parse2 };
|
||||
}
|
||||
});
|
||||
|
||||
// node_modules/node-webvtt/lib/compiler.js
|
||||
var require_compiler = __commonJS({
|
||||
"node_modules/node-webvtt/lib/compiler.js"(exports, module2) {
|
||||
"use strict";
|
||||
function CompilerError(message, error) {
|
||||
this.message = message;
|
||||
this.error = error;
|
||||
}
|
||||
CompilerError.prototype = Object.create(Error.prototype);
|
||||
function compile(input) {
|
||||
if (!input) {
|
||||
throw new CompilerError("Input must be non-null");
|
||||
}
|
||||
if (typeof input !== "object") {
|
||||
throw new CompilerError("Input must be an object");
|
||||
}
|
||||
if (Array.isArray(input)) {
|
||||
throw new CompilerError("Input cannot be array");
|
||||
}
|
||||
if (!input.valid) {
|
||||
throw new CompilerError("Input must be valid");
|
||||
}
|
||||
let output = "WEBVTT\n";
|
||||
if (input.meta) {
|
||||
if (typeof input.meta !== "object" || Array.isArray(input.meta)) {
|
||||
throw new CompilerError("Metadata must be an object");
|
||||
}
|
||||
Object.entries(input.meta).forEach((i) => {
|
||||
if (typeof i[1] !== "string") {
|
||||
throw new CompilerError(`Metadata value for "${i[0]}" must be string`);
|
||||
}
|
||||
output += `${i[0]}: ${i[1]}
|
||||
`;
|
||||
});
|
||||
}
|
||||
let lastTime = null;
|
||||
input.cues.forEach((cue, index) => {
|
||||
if (lastTime && lastTime > cue.start) {
|
||||
throw new CompilerError(`Cue number ${index} is not in chronological order`);
|
||||
}
|
||||
lastTime = cue.start;
|
||||
output += "\n";
|
||||
output += compileCue(cue);
|
||||
output += "\n";
|
||||
});
|
||||
return output;
|
||||
}
|
||||
function compileCue(cue) {
|
||||
if (typeof cue !== "object") {
|
||||
throw new CompilerError("Cue malformed: not of type object");
|
||||
}
|
||||
if (typeof cue.identifier !== "string" && typeof cue.identifier !== "number" && cue.identifier !== null) {
|
||||
throw new CompilerError(`Cue malformed: identifier value is not a string.
|
||||
${JSON.stringify(cue)}`);
|
||||
}
|
||||
if (isNaN(cue.start)) {
|
||||
throw new CompilerError(`Cue malformed: null start value.
|
||||
${JSON.stringify(cue)}`);
|
||||
}
|
||||
if (isNaN(cue.end)) {
|
||||
throw new CompilerError(`Cue malformed: null end value.
|
||||
${JSON.stringify(cue)}`);
|
||||
}
|
||||
if (cue.start >= cue.end) {
|
||||
throw new CompilerError(`Cue malformed: start timestamp greater than end
|
||||
${JSON.stringify(cue)}`);
|
||||
}
|
||||
if (typeof cue.text !== "string") {
|
||||
throw new CompilerError(`Cue malformed: null text value.
|
||||
${JSON.stringify(cue)}`);
|
||||
}
|
||||
if (typeof cue.styles !== "string") {
|
||||
throw new CompilerError(`Cue malformed: null styles value.
|
||||
${JSON.stringify(cue)}`);
|
||||
}
|
||||
let output = "";
|
||||
if (cue.identifier.length > 0) {
|
||||
output += `${cue.identifier}
|
||||
`;
|
||||
}
|
||||
const startTimestamp = convertTimestamp(cue.start);
|
||||
const endTimestamp = convertTimestamp(cue.end);
|
||||
output += `${startTimestamp} --> ${endTimestamp}`;
|
||||
output += cue.styles ? ` ${cue.styles}` : "";
|
||||
output += `
|
||||
${cue.text}`;
|
||||
return output;
|
||||
}
|
||||
function convertTimestamp(time) {
|
||||
const hours = pad(calculateHours(time), 2);
|
||||
const minutes = pad(calculateMinutes(time), 2);
|
||||
const seconds = pad(calculateSeconds(time), 2);
|
||||
const milliseconds = pad(calculateMs(time), 3);
|
||||
return `${hours}:${minutes}:${seconds}.${milliseconds}`;
|
||||
}
|
||||
function pad(num, zeroes) {
|
||||
let output = `${num}`;
|
||||
while (output.length < zeroes) {
|
||||
output = `0${output}`;
|
||||
}
|
||||
return output;
|
||||
}
|
||||
function calculateHours(time) {
|
||||
return Math.floor(time / 60 / 60);
|
||||
}
|
||||
function calculateMinutes(time) {
|
||||
return Math.floor(time / 60) % 60;
|
||||
}
|
||||
function calculateSeconds(time) {
|
||||
return Math.floor(time % 60);
|
||||
}
|
||||
function calculateMs(time) {
|
||||
return Math.floor((time % 1).toFixed(4) * 1e3);
|
||||
}
|
||||
module2.exports = { CompilerError, compile };
|
||||
}
|
||||
});
|
||||
|
||||
// node_modules/node-webvtt/lib/segmenter.js
|
||||
var require_segmenter = __commonJS({
|
||||
"node_modules/node-webvtt/lib/segmenter.js"(exports, module2) {
|
||||
"use strict";
|
||||
var parse2 = require_parser().parse;
|
||||
function segment(input, segmentLength) {
|
||||
segmentLength = segmentLength || 10;
|
||||
const parsed = parse2(input);
|
||||
const segments = [];
|
||||
let cues = [];
|
||||
let queuedCue = null;
|
||||
let currentSegmentDuration = 0;
|
||||
let totalSegmentsDuration = 0;
|
||||
parsed.cues.forEach((cue, i) => {
|
||||
const firstCue = i === 0;
|
||||
const lastCue = i === parsed.cues.length - 1;
|
||||
const start = cue.start;
|
||||
const end = cue.end;
|
||||
const nextStart = lastCue ? Infinity : parsed.cues[i + 1].start;
|
||||
const cueLength = firstCue ? end : end - start;
|
||||
const silence = firstCue ? 0 : start - parsed.cues[i - 1].end;
|
||||
currentSegmentDuration = currentSegmentDuration + cueLength + silence;
|
||||
debug("------------");
|
||||
debug(`Cue #${i}, segment #${segments.length + 1}`);
|
||||
debug(`Start ${start}`);
|
||||
debug(`End ${end}`);
|
||||
debug(`Length ${cueLength}`);
|
||||
debug(`Total segment duration = ${totalSegmentsDuration}`);
|
||||
debug(`Current segment duration = ${currentSegmentDuration}`);
|
||||
debug(`Start of next = ${nextStart}`);
|
||||
if (queuedCue) {
|
||||
cues.push(queuedCue);
|
||||
currentSegmentDuration += queuedCue.end - totalSegmentsDuration;
|
||||
queuedCue = null;
|
||||
}
|
||||
cues.push(cue);
|
||||
let shouldQueue = nextStart - end < segmentLength && silence < segmentLength && currentSegmentDuration > segmentLength;
|
||||
if (shouldSegment(totalSegmentsDuration, segmentLength, nextStart, silence)) {
|
||||
const duration = segmentDuration(lastCue, end, segmentLength, currentSegmentDuration, totalSegmentsDuration);
|
||||
segments.push({ duration, cues });
|
||||
totalSegmentsDuration += duration;
|
||||
currentSegmentDuration = 0;
|
||||
cues = [];
|
||||
} else {
|
||||
shouldQueue = false;
|
||||
}
|
||||
if (shouldQueue) {
|
||||
queuedCue = cue;
|
||||
}
|
||||
});
|
||||
return segments;
|
||||
}
|
||||
function shouldSegment(total, length, nextStart, silence) {
|
||||
const x = alignToSegmentLength(silence, length);
|
||||
const nextCueIsInNextSegment = silence <= length || x + total < nextStart;
|
||||
return nextCueIsInNextSegment && nextStart - total >= length;
|
||||
}
|
||||
function segmentDuration(lastCue, end, length, currentSegment, totalSegments) {
|
||||
let duration = length;
|
||||
if (currentSegment > length) {
|
||||
duration = alignToSegmentLength(currentSegment - length, length);
|
||||
}
|
||||
if (lastCue) {
|
||||
duration = parseFloat((end - totalSegments).toFixed(2));
|
||||
} else {
|
||||
duration = Math.round(duration);
|
||||
}
|
||||
return duration;
|
||||
}
|
||||
function alignToSegmentLength(n, segmentLength) {
|
||||
n += segmentLength - n % segmentLength;
|
||||
return n;
|
||||
}
|
||||
var debugging = false;
|
||||
function debug(m) {
|
||||
if (debugging) {
|
||||
console.log(m);
|
||||
}
|
||||
}
|
||||
module2.exports = { segment };
|
||||
}
|
||||
});
|
||||
|
||||
// node_modules/node-webvtt/lib/hls.js
|
||||
var require_hls = __commonJS({
|
||||
"node_modules/node-webvtt/lib/hls.js"(exports, module2) {
|
||||
"use strict";
|
||||
var segment = require_segmenter().segment;
|
||||
function hlsSegment(input, segmentLength, startOffset) {
|
||||
if (typeof startOffset === "undefined") {
|
||||
startOffset = "900000";
|
||||
}
|
||||
const segments = segment(input, segmentLength);
|
||||
const result = [];
|
||||
segments.forEach((seg, i) => {
|
||||
const content = `WEBVTT
|
||||
X-TIMESTAMP-MAP=MPEGTS:${startOffset},LOCAL:00:00:00.000
|
||||
|
||||
${printableCues(seg.cues)}
|
||||
`;
|
||||
const filename = generateSegmentFilename(i);
|
||||
result.push({ filename, content });
|
||||
});
|
||||
return result;
|
||||
}
|
||||
function hlsSegmentPlaylist(input, segmentLength) {
|
||||
const segmented = segment(input, segmentLength);
|
||||
const printable = printableSegments(segmented);
|
||||
const longestSegment = Math.round(findLongestSegment(segmented));
|
||||
const template = `#EXTM3U
|
||||
#EXT-X-TARGETDURATION:${longestSegment}
|
||||
#EXT-X-VERSION:3
|
||||
#EXT-X-MEDIA-SEQUENCE:0
|
||||
#EXT-X-PLAYLIST-TYPE:VOD
|
||||
${printable}
|
||||
#EXT-X-ENDLIST
|
||||
`;
|
||||
return template;
|
||||
}
|
||||
function pad(num, n) {
|
||||
const padding = "0".repeat(Math.max(0, n - num.toString().length));
|
||||
return `${padding}${num}`;
|
||||
}
|
||||
function generateSegmentFilename(index) {
|
||||
return `${index}.vtt`;
|
||||
}
|
||||
function printableSegments(segments) {
|
||||
const result = [];
|
||||
segments.forEach((seg, i) => {
|
||||
result.push(`#EXTINF:${seg.duration.toFixed(5)},
|
||||
${generateSegmentFilename(i)}`);
|
||||
});
|
||||
return result.join("\n");
|
||||
}
|
||||
function findLongestSegment(segments) {
|
||||
let max = 0;
|
||||
segments.forEach((seg) => {
|
||||
if (seg.duration > max) {
|
||||
max = seg.duration;
|
||||
}
|
||||
});
|
||||
return max;
|
||||
}
|
||||
function printableCues(cues) {
|
||||
const result = [];
|
||||
cues.forEach((cue) => {
|
||||
result.push(printableCue(cue));
|
||||
});
|
||||
return result.join("\n\n");
|
||||
}
|
||||
function printableCue(cue) {
|
||||
const printable = [];
|
||||
if (cue.identifier) {
|
||||
printable.push(cue.identifier);
|
||||
}
|
||||
const start = printableTimestamp(cue.start);
|
||||
const end = printableTimestamp(cue.end);
|
||||
const styles = cue.styles ? `${cue.styles}` : "";
|
||||
printable.push(`${start} --> ${end} ${styles}`);
|
||||
printable.push(cue.text);
|
||||
return printable.join("\n");
|
||||
}
|
||||
function printableTimestamp(timestamp) {
|
||||
const ms = (timestamp % 1).toFixed(3);
|
||||
timestamp = Math.round(timestamp - ms);
|
||||
const hours = Math.floor(timestamp / 3600);
|
||||
const mins = Math.floor((timestamp - hours * 3600) / 60);
|
||||
const secs = timestamp - hours * 3600 - mins * 60;
|
||||
const hourString = `${pad(hours, 2)}:`;
|
||||
return `${hourString}${pad(mins, 2)}:${pad(secs, 2)}.${pad(ms * 1e3, 3)}`;
|
||||
}
|
||||
module2.exports = { hlsSegment, hlsSegmentPlaylist };
|
||||
}
|
||||
});
|
||||
|
||||
// node_modules/node-webvtt/index.js
|
||||
var require_node_webvtt = __commonJS({
|
||||
"node_modules/node-webvtt/index.js"(exports, module2) {
|
||||
"use strict";
|
||||
var parse2 = require_parser().parse;
|
||||
var compile = require_compiler().compile;
|
||||
var segment = require_segmenter().segment;
|
||||
var hls = require_hls();
|
||||
module2.exports = { parse: parse2, compile, segment, hls };
|
||||
}
|
||||
});
|
||||
|
||||
// main.ts
|
||||
__export(exports, {
|
||||
default: () => ChatViewPlugin
|
||||
});
|
||||
var import_obsidian = __toModule(require("obsidian"));
|
||||
var webvtt = __toModule(require_node_webvtt());
|
||||
var KEYMAP = { ">": "right", "<": "left", "^": "center" };
|
||||
var CONFIGS = {
|
||||
"header": ["h2", "h3", "h4", "h5", "h6"],
|
||||
"mw": ["50", "55", "60", "65", "70", "75", "80", "85", "90"],
|
||||
"mode": ["default", "minimal"]
|
||||
};
|
||||
var COLORS = [
|
||||
"red",
|
||||
"orange",
|
||||
"yellow",
|
||||
"green",
|
||||
"blue",
|
||||
"purple",
|
||||
"grey",
|
||||
"brown",
|
||||
"indigo",
|
||||
"teal",
|
||||
"pink",
|
||||
"slate",
|
||||
"wood"
|
||||
];
|
||||
var _ChatPatterns = class {
|
||||
};
|
||||
var ChatPatterns = _ChatPatterns;
|
||||
ChatPatterns.message = /(^>|<|\^)/;
|
||||
ChatPatterns.delimiter = /.../;
|
||||
ChatPatterns.comment = /^#/;
|
||||
ChatPatterns.colors = /\[(.*?)\]/;
|
||||
ChatPatterns.format = /{(.*?)}/;
|
||||
ChatPatterns.joined = RegExp([_ChatPatterns.message, _ChatPatterns.delimiter, _ChatPatterns.colors, _ChatPatterns.comment, _ChatPatterns.format].map((pattern) => pattern.source).join("|"));
|
||||
ChatPatterns.voice = /<v\s+([^>]+)>([^<]+)<\/v>/;
|
||||
var ChatViewPlugin = class extends import_obsidian.Plugin {
|
||||
onload() {
|
||||
return __async(this, null, function* () {
|
||||
this.registerMarkdownCodeBlockProcessor("chat-webvtt", (source, el, _) => {
|
||||
const vtt = webvtt.parse(source, { meta: true });
|
||||
const messages = [];
|
||||
const self = vtt.meta && "Self" in vtt.meta ? vtt.meta.Self : void 0;
|
||||
const selves = self ? self.split(",").map((val) => val.trim()) : void 0;
|
||||
const formatConfigs = new Map();
|
||||
const maxWidth = vtt.meta && "MaxWidth" in vtt.meta ? vtt.meta.MaxWidth : void 0;
|
||||
const headerConfig = vtt.meta && "Header" in vtt.meta ? vtt.meta.Header : void 0;
|
||||
const modeConfig = vtt.meta && "Mode" in vtt.meta ? vtt.meta.Mode : void 0;
|
||||
if (CONFIGS["mw"].contains(maxWidth))
|
||||
formatConfigs.set("mw", maxWidth);
|
||||
if (CONFIGS["header"].contains(headerConfig))
|
||||
formatConfigs.set("header", headerConfig);
|
||||
if (CONFIGS["mode"].contains(modeConfig))
|
||||
formatConfigs.set("mode", modeConfig);
|
||||
console.log(formatConfigs);
|
||||
for (let index = 0; index < vtt.cues.length; index++) {
|
||||
const cue = vtt.cues[index];
|
||||
const start = (0, import_obsidian.moment)(Math.round(cue.start * 1e3)).format("HH:mm:ss.SSS");
|
||||
const end = (0, import_obsidian.moment)(Math.round(cue.end * 1e3)).format("HH:mm:ss.SSS");
|
||||
if (ChatPatterns.voice.test(cue.text)) {
|
||||
const matches = cue.text.match(ChatPatterns.voice);
|
||||
messages.push({ header: matches[1], body: matches[2], subtext: `${start} to ${end}` });
|
||||
} else {
|
||||
messages.push({ header: "", body: cue.text, subtext: `${start} to ${end}` });
|
||||
}
|
||||
}
|
||||
const headers = messages.map((message) => message.header);
|
||||
const uniqueHeaders = new Set(headers);
|
||||
uniqueHeaders.delete("");
|
||||
console.log(messages);
|
||||
console.log(uniqueHeaders);
|
||||
const colorConfigs = new Map();
|
||||
Array.from(uniqueHeaders).forEach((h, i) => colorConfigs.set(h, COLORS[i % COLORS.length]));
|
||||
console.log(colorConfigs);
|
||||
messages.forEach((message, index, arr) => {
|
||||
const prevHeader = index > 0 ? arr[index - 1].header : "";
|
||||
const align = selves && selves.contains(message.header) ? "right" : "left";
|
||||
const continued = message.header === prevHeader;
|
||||
this.createChatBubble(continued ? "" : message.header, prevHeader, message.body, message.subtext, align, el, continued, colorConfigs, formatConfigs);
|
||||
});
|
||||
});
|
||||
this.registerMarkdownCodeBlockProcessor("chat", (source, el, _) => {
|
||||
const rawLines = source.split("\n").filter((line) => ChatPatterns.joined.test(line.trim()));
|
||||
const lines = rawLines.map((rawLine) => rawLine.trim());
|
||||
const formatConfigs = new Map();
|
||||
const colorConfigs = new Map();
|
||||
for (const line of lines) {
|
||||
if (ChatPatterns.format.test(line)) {
|
||||
const configs = line.replace("{", "").replace("}", "").split(",").map((l) => l.trim());
|
||||
for (const config of configs) {
|
||||
const [k, v] = config.split("=").map((c) => c.trim());
|
||||
if (Object.keys(CONFIGS).contains(k) && CONFIGS[k].contains(v))
|
||||
formatConfigs.set(k, v);
|
||||
}
|
||||
} else if (ChatPatterns.colors.test(line)) {
|
||||
const configs = line.replace("[", "").replace("]", "").split(",").map((l) => l.trim());
|
||||
for (const config of configs) {
|
||||
const [k, v] = config.split("=").map((c) => c.trim());
|
||||
if (k.length > 0 && COLORS.contains(v))
|
||||
colorConfigs.set(k, v);
|
||||
}
|
||||
}
|
||||
}
|
||||
let continuedCount = 0;
|
||||
for (let index = 0; index < lines.length; index++) {
|
||||
const line = lines[index].trim();
|
||||
if (ChatPatterns.comment.test(line)) {
|
||||
el.createEl("p", { text: line.substring(1).trim(), cls: ["chat-view-comment"] });
|
||||
} else if (line === "...") {
|
||||
const delimiter = el.createDiv({ cls: ["delimiter"] });
|
||||
for (let i = 0; i < 3; i++)
|
||||
delimiter.createDiv({ cls: ["dot"] });
|
||||
} else if (ChatPatterns.message.test(line)) {
|
||||
const components = line.substring(1).split("|");
|
||||
if (components.length > 0) {
|
||||
const first = components[0];
|
||||
const header = components.length > 1 ? first.trim() : "";
|
||||
const message = components.length > 1 ? components[1].trim() : first.trim();
|
||||
const subtext = components.length > 2 ? components[2].trim() : "";
|
||||
const continued = index > 0 && line.charAt(0) === lines[index - 1].charAt(0) && header === "";
|
||||
let prevHeader = "";
|
||||
if (continued) {
|
||||
continuedCount++;
|
||||
const prevComponents = lines[index - continuedCount].trim().substring(1).split("|");
|
||||
prevHeader = prevComponents[0].length > 1 ? prevComponents[0].trim() : "";
|
||||
} else {
|
||||
continuedCount = 0;
|
||||
}
|
||||
this.createChatBubble(header, prevHeader, message, subtext, KEYMAP[line.charAt(0)], el, continued, colorConfigs, formatConfigs);
|
||||
}
|
||||
}
|
||||
}
|
||||
});
|
||||
});
|
||||
}
|
||||
createChatBubble(header, prevHeader, message, subtext, align, element, continued, colorConfigs, formatConfigs) {
|
||||
const marginClass = continued ? "chat-view-small-vertical-margin" : "chat-view-default-vertical-margin";
|
||||
const colorConfigClass = `chat-view-${colorConfigs.get(continued ? prevHeader : header)}`;
|
||||
const widthClass = formatConfigs.has("mw") ? `chat-view-max-width-${formatConfigs.get("mw")}` : import_obsidian.Platform.isMobile ? "chat-view-mobile-width" : "chat-view-desktop-width";
|
||||
const modeClass = `chat-view-bubble-mode-${formatConfigs.has("mode") ? formatConfigs.get("mode") : "default"}`;
|
||||
const headerEl = formatConfigs.has("header") ? formatConfigs.get("header") : "h4";
|
||||
const bubble = element.createDiv({
|
||||
cls: ["chat-view-bubble", `chat-view-align-${align}`, marginClass, colorConfigClass, widthClass, modeClass]
|
||||
});
|
||||
if (header.length > 0)
|
||||
bubble.createEl(headerEl, { text: header, cls: ["chat-view-header"] });
|
||||
if (message.length > 0)
|
||||
bubble.createEl("p", { text: message, cls: ["chat-view-message"] });
|
||||
if (subtext.length > 0)
|
||||
bubble.createEl("sub", { text: subtext, cls: ["chat-view-subtext"] });
|
||||
}
|
||||
};
|
||||
@ -1,9 +0,0 @@
|
||||
{
|
||||
"id": "obsidian-chat-view",
|
||||
"name": "Chat View",
|
||||
"version": "1.2.0",
|
||||
"minAppVersion": "0.12.0",
|
||||
"description": "Chat View enables you to create elegant Chat UIs in your Obsidian markdown files. It also supports the WebVTT format.",
|
||||
"author": "Aditya Majethia",
|
||||
"isDesktopOnly": false
|
||||
}
|
||||
@ -1,200 +0,0 @@
|
||||
:root {
|
||||
--opacity: 0.6;
|
||||
--line-height: 1.8;
|
||||
--line-height-minimal: 1.6;
|
||||
}
|
||||
|
||||
div.chat-view-bubble-mode-default>h2.chat-view-header,
|
||||
div.chat-view-bubble-mode-default>h3.chat-view-header,
|
||||
div.chat-view-bubble-mode-default>h4.chat-view-header,
|
||||
div.chat-view-bubble-mode-default>h5.chat-view-header,
|
||||
div.chat-view-bubble-mode-default>h6.chat-view-header {
|
||||
margin: 0;
|
||||
margin-bottom: 8px;
|
||||
}
|
||||
|
||||
div.chat-view-bubble-mode-minimal>h2.chat-view-header,
|
||||
div.chat-view-bubble-mode-minimal>h3.chat-view-header,
|
||||
div.chat-view-bubble-mode-minimal>h4.chat-view-header,
|
||||
div.chat-view-bubble-mode-minimal>h5.chat-view-header,
|
||||
div.chat-view-bubble-mode-minimal>h6.chat-view-header {
|
||||
margin: 0;
|
||||
margin-bottom: 4px;
|
||||
}
|
||||
|
||||
div.chat-view-bubble-mode-default>p.chat-view-message {
|
||||
margin: 0;
|
||||
margin-bottom: 2px;
|
||||
line-height: var(--line-height);
|
||||
}
|
||||
|
||||
div.chat-view-bubble-mode-minimal>p.chat-view-message {
|
||||
margin: 0;
|
||||
line-height: var(--line-height-minimal);
|
||||
}
|
||||
|
||||
sub.chat-view-subtext {
|
||||
opacity: var(--opacity);
|
||||
}
|
||||
|
||||
.chat-view-comment {
|
||||
width: fit-content;
|
||||
max-width: 90%;
|
||||
margin: 24px auto;
|
||||
line-height: var(--line-height);
|
||||
text-align: center;
|
||||
opacity: var(--opacity);
|
||||
}
|
||||
|
||||
div.chat-view-bubble {
|
||||
width: fit-content;
|
||||
min-width: 30%;
|
||||
}
|
||||
|
||||
div.chat-view-bubble-mode-default {
|
||||
padding: 12px;
|
||||
background-color: rgba(0, 0, 0, 0.075);
|
||||
border: 2px solid rgba(255, 255, 255, 0.15);
|
||||
border-radius: 16px;
|
||||
}
|
||||
|
||||
div.chat-view-bubble-mode-minimal {
|
||||
padding: 4px 0px;
|
||||
background-color: transparent;
|
||||
}
|
||||
|
||||
.chat-view-mobile-width {
|
||||
max-width: 85%;
|
||||
}
|
||||
|
||||
.chat-view-desktop-width {
|
||||
max-width: 75%;
|
||||
}
|
||||
|
||||
.chat-view-max-width-50 {
|
||||
max-width: 50%;
|
||||
}
|
||||
|
||||
.chat-view-max-width-55 {
|
||||
max-width: 55%;
|
||||
}
|
||||
|
||||
.chat-view-max-width-60 {
|
||||
max-width: 60%;
|
||||
}
|
||||
|
||||
.chat-view-max-width-65 {
|
||||
max-width: 65%;
|
||||
}
|
||||
|
||||
.chat-view-max-width-70 {
|
||||
max-width: 70%;
|
||||
}
|
||||
|
||||
.chat-view-max-width-75 {
|
||||
max-width: 75%;
|
||||
}
|
||||
|
||||
.chat-view-max-width-80 {
|
||||
max-width: 80%;
|
||||
}
|
||||
|
||||
.chat-view-max-width-85 {
|
||||
max-width: 85%;
|
||||
}
|
||||
|
||||
.chat-view-max-width-90 {
|
||||
max-width: 90%;
|
||||
}
|
||||
|
||||
div.chat-view-default-vertical-margin {
|
||||
margin-top: 18px;
|
||||
}
|
||||
|
||||
div.chat-view-small-vertical-margin {
|
||||
margin-top: 12px;
|
||||
}
|
||||
|
||||
div.chat-view-align-left {
|
||||
border-top-left-radius: 0;
|
||||
margin-left: 0;
|
||||
margin-right: auto;
|
||||
}
|
||||
|
||||
div.chat-view-align-right {
|
||||
border-top-right-radius: 0;
|
||||
margin-left: auto;
|
||||
margin-right: 0;
|
||||
}
|
||||
|
||||
div.chat-view-align-center {
|
||||
margin-left: auto;
|
||||
margin-right: auto;
|
||||
}
|
||||
|
||||
div.delimiter {
|
||||
width: fit-content;
|
||||
margin: 24px auto;
|
||||
}
|
||||
|
||||
div.delimiter div.dot {
|
||||
display: inline-block;
|
||||
width: 6px;
|
||||
height: 6px;
|
||||
margin: 0px 4px;
|
||||
border-radius: 60%;
|
||||
background-color: currentColor;
|
||||
opacity: var(--opacity);
|
||||
}
|
||||
|
||||
div.chat-view-blue>.chat-view-header {
|
||||
color: #08F;
|
||||
}
|
||||
|
||||
div.chat-view-green>.chat-view-header {
|
||||
color: #2B5;
|
||||
}
|
||||
|
||||
div.chat-view-yellow>.chat-view-header {
|
||||
color: #ED0;
|
||||
}
|
||||
|
||||
div.chat-view-orange>.chat-view-header {
|
||||
color: #F80;
|
||||
}
|
||||
|
||||
div.chat-view-red>.chat-view-header {
|
||||
color: #F33;
|
||||
}
|
||||
|
||||
div.chat-view-purple>.chat-view-header {
|
||||
color: #B2C;
|
||||
}
|
||||
|
||||
div.chat-view-grey>.chat-view-header {
|
||||
color: #999;
|
||||
}
|
||||
|
||||
div.chat-view-brown .chat-view-header {
|
||||
color: #A71;
|
||||
}
|
||||
|
||||
div.chat-view-indigo .chat-view-header {
|
||||
color: #75F;
|
||||
}
|
||||
|
||||
div.chat-view-teal .chat-view-header {
|
||||
color: #0AA;
|
||||
}
|
||||
|
||||
div.chat-view-pink .chat-view-header {
|
||||
color: #F2A;
|
||||
}
|
||||
|
||||
div.chat-view-slate .chat-view-header {
|
||||
color: #78A;
|
||||
}
|
||||
|
||||
div.chat-view-wood .chat-view-header {
|
||||
color: #EE6a44;
|
||||
}
|
||||
@ -0,0 +1,340 @@
|
||||
/*
|
||||
THIS IS A GENERATED/BUNDLED FILE BY ESBUILD
|
||||
if you want to view the source, please visit the github repository of this plugin
|
||||
*/
|
||||
|
||||
var __create = Object.create;
|
||||
var __defProp = Object.defineProperty;
|
||||
var __getOwnPropDesc = Object.getOwnPropertyDescriptor;
|
||||
var __getOwnPropNames = Object.getOwnPropertyNames;
|
||||
var __getProtoOf = Object.getPrototypeOf;
|
||||
var __hasOwnProp = Object.prototype.hasOwnProperty;
|
||||
var __markAsModule = (target) => __defProp(target, "__esModule", { value: true });
|
||||
var __export = (target, all) => {
|
||||
__markAsModule(target);
|
||||
for (var name in all)
|
||||
__defProp(target, name, { get: all[name], enumerable: true });
|
||||
};
|
||||
var __reExport = (target, module2, desc) => {
|
||||
if (module2 && typeof module2 === "object" || typeof module2 === "function") {
|
||||
for (let key of __getOwnPropNames(module2))
|
||||
if (!__hasOwnProp.call(target, key) && key !== "default")
|
||||
__defProp(target, key, { get: () => module2[key], enumerable: !(desc = __getOwnPropDesc(module2, key)) || desc.enumerable });
|
||||
}
|
||||
return target;
|
||||
};
|
||||
var __toModule = (module2) => {
|
||||
return __reExport(__markAsModule(__defProp(module2 != null ? __create(__getProtoOf(module2)) : {}, "default", module2 && module2.__esModule && "default" in module2 ? { get: () => module2.default, enumerable: true } : { value: module2, enumerable: true })), module2);
|
||||
};
|
||||
var __async = (__this, __arguments, generator) => {
|
||||
return new Promise((resolve, reject) => {
|
||||
var fulfilled = (value) => {
|
||||
try {
|
||||
step(generator.next(value));
|
||||
} catch (e) {
|
||||
reject(e);
|
||||
}
|
||||
};
|
||||
var rejected = (value) => {
|
||||
try {
|
||||
step(generator.throw(value));
|
||||
} catch (e) {
|
||||
reject(e);
|
||||
}
|
||||
};
|
||||
var step = (x) => x.done ? resolve(x.value) : Promise.resolve(x.value).then(fulfilled, rejected);
|
||||
step((generator = generator.apply(__this, __arguments)).next());
|
||||
});
|
||||
};
|
||||
|
||||
// src/main.ts
|
||||
__export(exports, {
|
||||
default: () => DialoguePlugin
|
||||
});
|
||||
var import_obsidian2 = __toModule(require("obsidian"));
|
||||
|
||||
// src/types/dialogueTitleMode.ts
|
||||
var DialogueTitleMode;
|
||||
(function(DialogueTitleMode2) {
|
||||
DialogueTitleMode2["Disabled"] = "disabled";
|
||||
DialogueTitleMode2["First"] = "first";
|
||||
DialogueTitleMode2["All"] = "all";
|
||||
})(DialogueTitleMode || (DialogueTitleMode = {}));
|
||||
|
||||
// src/constants/classes.ts
|
||||
var CLASSES = class {
|
||||
};
|
||||
CLASSES.DIALOGUE_WRAPPER = "dialogue-plugin-wrapper";
|
||||
CLASSES.BLOCK_WRAPPER = "dialogue-plugin-block-wrapper";
|
||||
CLASSES.MESSAGE_WRAPPER_LEFT = "dialogue-plugin-message-wrapper-left";
|
||||
CLASSES.MESSAGE_WRAPPER_RIGHT = "dialogue-plugin-message-wrapper-right";
|
||||
CLASSES.MESSAGE = "dialogue-plugin-message";
|
||||
CLASSES.MESSAGE_TITLE = "dialogue-plugin-message-title";
|
||||
CLASSES.MESSAGE_CONTENT = "dialogue-plugin-message-content";
|
||||
CLASSES.DELIMITER_WRAPPER = "dialogue-plugin-delimiter-wrapper";
|
||||
CLASSES.DELIMITER = "dialogue-plugin-delimiter";
|
||||
CLASSES.DELIMITER_DOT = "dialogue-plugin-delimiter-dot";
|
||||
CLASSES.COMMENT_WRAPPER = "dialogue-plugin-comment-wrapper";
|
||||
CLASSES.COMMENT = "dialogue-plugin-comment";
|
||||
|
||||
// src/components/message.ts
|
||||
var SIDES = class {
|
||||
};
|
||||
SIDES.LEFT = "left";
|
||||
SIDES.RIGHT = "right";
|
||||
var Message = class {
|
||||
constructor(content, side, dialogueSettings) {
|
||||
this.content = content;
|
||||
this.side = side;
|
||||
this.dialogueSettings = dialogueSettings;
|
||||
this.participant = this.side == SIDES.LEFT ? this.dialogueSettings.leftParticipant : this.dialogueSettings.rightParticipant;
|
||||
this.renderMessage();
|
||||
}
|
||||
renderMessage() {
|
||||
const messageEl = this.createMessageEl();
|
||||
if (this.titleShouldRender()) {
|
||||
messageEl.createDiv({ cls: CLASSES.MESSAGE_TITLE, text: this.participant.title });
|
||||
}
|
||||
messageEl.createDiv({ cls: CLASSES.MESSAGE_CONTENT, text: this.content });
|
||||
}
|
||||
createMessageEl() {
|
||||
var _a;
|
||||
const sideClass = this.side == SIDES.LEFT ? CLASSES.MESSAGE_WRAPPER_LEFT : CLASSES.MESSAGE_WRAPPER_RIGHT;
|
||||
const messageWrapperEl = this.dialogueSettings.parent.createDiv({
|
||||
cls: `${CLASSES.BLOCK_WRAPPER} ${sideClass}`
|
||||
});
|
||||
return messageWrapperEl.createDiv({
|
||||
cls: CLASSES.MESSAGE,
|
||||
attr: {
|
||||
style: `max-width: ${this.dialogueSettings.messageMaxWidth};`,
|
||||
"data-participant-name": this.participant.title,
|
||||
"data-participant-id": (_a = this.participant.enforcedId) != null ? _a : this.dialogueSettings.participants.get(this.participant.title)
|
||||
}
|
||||
});
|
||||
}
|
||||
titleShouldRender() {
|
||||
if (this.participant.title.length < 1)
|
||||
return false;
|
||||
switch (this.dialogueSettings.titleMode) {
|
||||
case DialogueTitleMode.Disabled:
|
||||
return false;
|
||||
case DialogueTitleMode.All:
|
||||
return true;
|
||||
case DialogueTitleMode.First: {
|
||||
if (this.participant.renderedOnce)
|
||||
return false;
|
||||
this.participant.renderedOnce = true;
|
||||
return true;
|
||||
}
|
||||
default:
|
||||
return false;
|
||||
}
|
||||
}
|
||||
};
|
||||
|
||||
// src/components/delimiter.ts
|
||||
var Delimiter = class {
|
||||
constructor(dialogueSettings) {
|
||||
this.dialogueSettings = dialogueSettings;
|
||||
this.renderDelimiter();
|
||||
}
|
||||
renderDelimiter() {
|
||||
const delimiterWrapperEl = this.dialogueSettings.parent.createDiv({
|
||||
cls: `${CLASSES.BLOCK_WRAPPER} ${CLASSES.DELIMITER_WRAPPER}`
|
||||
});
|
||||
const delimiterEl = delimiterWrapperEl.createDiv({ cls: CLASSES.DELIMITER });
|
||||
delimiterEl.createEl("div", { cls: CLASSES.DELIMITER_DOT });
|
||||
delimiterEl.createEl("div", { cls: CLASSES.DELIMITER_DOT });
|
||||
delimiterEl.createEl("div", { cls: CLASSES.DELIMITER_DOT });
|
||||
}
|
||||
};
|
||||
|
||||
// src/components/comment.ts
|
||||
var Comment = class {
|
||||
constructor(content, dialogueSettings) {
|
||||
this.content = content;
|
||||
this.dialogueSettings = dialogueSettings;
|
||||
this.renderComment();
|
||||
}
|
||||
renderComment() {
|
||||
const commentEl = this.dialogueSettings.parent.createDiv({
|
||||
cls: `${CLASSES.BLOCK_WRAPPER} ${CLASSES.COMMENT_WRAPPER}`
|
||||
});
|
||||
return commentEl.createDiv({
|
||||
cls: CLASSES.COMMENT,
|
||||
text: this.content,
|
||||
attr: {
|
||||
style: `max-width: ${this.dialogueSettings.commentMaxWidth};`
|
||||
}
|
||||
});
|
||||
}
|
||||
};
|
||||
|
||||
// src/dialogue.ts
|
||||
var KEYWORDS = class {
|
||||
};
|
||||
KEYWORDS.LEFT_PATTERN = /^l(?:eft)?(?:-(\d+))?:/i;
|
||||
KEYWORDS.RIGHT_PATTERN = /^r(?:ight)?(?:-(\d+))?:/i;
|
||||
KEYWORDS.TITLE_MODE = "titleMode:";
|
||||
KEYWORDS.MESSAGE_MAX_WIDTH = "messageMaxWidth:";
|
||||
KEYWORDS.COMMENT_MAX_WIDTH = "commentMaxWidth:";
|
||||
KEYWORDS.DELIMITER = /^-|delimiter/;
|
||||
KEYWORDS.COMMENT = "#";
|
||||
KEYWORDS.MESSAGE_LEFT = "<";
|
||||
KEYWORDS.MESSAGE_RIGHT = ">";
|
||||
var DialogueRenderer = class {
|
||||
constructor(src, parent, settings) {
|
||||
this.src = src;
|
||||
this.dialogueWrapperEl = parent.createDiv({ cls: CLASSES.DIALOGUE_WRAPPER });
|
||||
this.dialogueSettings = {
|
||||
parent: this.dialogueWrapperEl,
|
||||
leftParticipant: {
|
||||
title: settings.defaultLeftTitle,
|
||||
renderedOnce: false,
|
||||
enforcedId: null
|
||||
},
|
||||
rightParticipant: {
|
||||
title: settings.defaultRightTitle,
|
||||
renderedOnce: false,
|
||||
enforcedId: null
|
||||
},
|
||||
titleMode: settings.defaultTitleMode,
|
||||
messageMaxWidth: settings.defaultMessageMaxWidth,
|
||||
commentMaxWidth: settings.defaultCommentMaxWidth,
|
||||
participants: new Map()
|
||||
};
|
||||
this.renderDialogue();
|
||||
}
|
||||
registerParticipant(participant) {
|
||||
if (!this.dialogueSettings.participants.has(participant)) {
|
||||
this.dialogueSettings.participants.set(participant, this.dialogueSettings.participants.size + 1);
|
||||
}
|
||||
}
|
||||
getEnforcedId(pattern, line) {
|
||||
let enforcedId = null;
|
||||
const result = pattern.exec(line);
|
||||
if (result != null && result.length > 1) {
|
||||
enforcedId = result[1];
|
||||
}
|
||||
return enforcedId;
|
||||
}
|
||||
renderDialogue() {
|
||||
const lines = this.src.split(/\r?\n/).map((line) => line.trim()).filter((line) => line.length > 0);
|
||||
for (const line of lines) {
|
||||
if (KEYWORDS.LEFT_PATTERN.test(line)) {
|
||||
this.dialogueSettings.leftParticipant.title = line.split(":").splice(1).join(":").trim();
|
||||
this.dialogueSettings.leftParticipant.renderedOnce = false;
|
||||
this.dialogueSettings.leftParticipant.enforcedId = this.getEnforcedId(KEYWORDS.LEFT_PATTERN, line);
|
||||
} else if (KEYWORDS.RIGHT_PATTERN.test(line)) {
|
||||
this.dialogueSettings.rightParticipant.title = line.split(":").splice(1).join(":").trim();
|
||||
this.dialogueSettings.rightParticipant.renderedOnce = false;
|
||||
this.dialogueSettings.rightParticipant.enforcedId = this.getEnforcedId(KEYWORDS.RIGHT_PATTERN, line);
|
||||
} else if (line.startsWith(KEYWORDS.TITLE_MODE)) {
|
||||
const modeName = line.substr(KEYWORDS.TITLE_MODE.length).trim().toLowerCase();
|
||||
if (Object.values(DialogueTitleMode).some((mode) => mode == modeName)) {
|
||||
this.dialogueSettings.titleMode = modeName;
|
||||
}
|
||||
} else if (line.startsWith(KEYWORDS.MESSAGE_MAX_WIDTH)) {
|
||||
this.dialogueSettings.messageMaxWidth = line.substr(KEYWORDS.MESSAGE_MAX_WIDTH.length).trim();
|
||||
} else if (line.startsWith(KEYWORDS.COMMENT_MAX_WIDTH)) {
|
||||
this.dialogueSettings.commentMaxWidth = line.substr(KEYWORDS.COMMENT_MAX_WIDTH.length).trim();
|
||||
} else if (KEYWORDS.DELIMITER.test(line)) {
|
||||
new Delimiter(this.dialogueSettings);
|
||||
} else if (line.startsWith(KEYWORDS.COMMENT)) {
|
||||
const content = line.substr(KEYWORDS.COMMENT.length);
|
||||
new Comment(content, this.dialogueSettings);
|
||||
} else if (line.startsWith(KEYWORDS.MESSAGE_LEFT)) {
|
||||
const content = line.substr(KEYWORDS.MESSAGE_LEFT.length);
|
||||
this.registerParticipant(this.dialogueSettings.leftParticipant.title);
|
||||
new Message(content, SIDES.LEFT, this.dialogueSettings);
|
||||
} else if (line.startsWith(KEYWORDS.MESSAGE_RIGHT)) {
|
||||
const content = line.substr(KEYWORDS.MESSAGE_RIGHT.length);
|
||||
this.registerParticipant(this.dialogueSettings.rightParticipant.title);
|
||||
new Message(content, SIDES.RIGHT, this.dialogueSettings);
|
||||
}
|
||||
}
|
||||
}
|
||||
};
|
||||
|
||||
// src/settings.ts
|
||||
var import_obsidian = __toModule(require("obsidian"));
|
||||
var DEFAULT_SETTINGS = {
|
||||
defaultLeftTitle: "",
|
||||
defaultRightTitle: "",
|
||||
defaultTitleMode: DialogueTitleMode.First,
|
||||
defaultMessageMaxWidth: "60%",
|
||||
defaultCommentMaxWidth: "60%"
|
||||
};
|
||||
var DialogueSettingTab = class extends import_obsidian.PluginSettingTab {
|
||||
constructor(app, plugin) {
|
||||
super(app, plugin);
|
||||
this.plugin = plugin;
|
||||
}
|
||||
display() {
|
||||
const { containerEl } = this;
|
||||
containerEl.empty();
|
||||
containerEl.createEl("h2", { text: "Dialogue Settings" });
|
||||
const coffeeEl = containerEl.createEl("div", {
|
||||
attr: {
|
||||
style: "text-align: center; margin-bottom: 10px;"
|
||||
}
|
||||
});
|
||||
const coffeeLinkEl = coffeeEl.createEl("a", { href: "https://www.buymeacoffee.com/holubj" });
|
||||
coffeeLinkEl.createEl("img", {
|
||||
attr: {
|
||||
src: "https://cdn.buymeacoffee.com/buttons/v2/default-yellow.png",
|
||||
alt: "Buy Me A Coffee",
|
||||
style: "height: 60px; width: 217px;"
|
||||
}
|
||||
});
|
||||
new import_obsidian.Setting(containerEl).setName("Default left title").setDesc("Default value for left title in all dialogues.").addText((text) => text.setPlaceholder("Enter default left title").setValue(this.plugin.settings.defaultLeftTitle).onChange((value) => __async(this, null, function* () {
|
||||
this.plugin.settings.defaultLeftTitle = value;
|
||||
yield this.plugin.saveSettings();
|
||||
})));
|
||||
new import_obsidian.Setting(containerEl).setName("Default right title").setDesc("Default value for right title in all dialogues.").addText((text) => text.setPlaceholder("Enter default right title").setValue(this.plugin.settings.defaultRightTitle).onChange((value) => __async(this, null, function* () {
|
||||
this.plugin.settings.defaultRightTitle = value;
|
||||
yield this.plugin.saveSettings();
|
||||
})));
|
||||
new import_obsidian.Setting(containerEl).setName("Default title mode").setDesc("Default title mode in all dialogues.").addDropdown((cb) => {
|
||||
Object.values(DialogueTitleMode).forEach((titleMode) => {
|
||||
const mode = titleMode.toString();
|
||||
cb.addOption(mode, mode.charAt(0).toUpperCase() + mode.slice(1));
|
||||
});
|
||||
cb.setValue(this.plugin.settings.defaultTitleMode).onChange((value) => __async(this, null, function* () {
|
||||
this.plugin.settings.defaultTitleMode = value;
|
||||
yield this.plugin.saveSettings();
|
||||
}));
|
||||
});
|
||||
new import_obsidian.Setting(containerEl).setName("Default max message width").setDesc("Default max message width in all dialogues.").addText((text) => text.setPlaceholder("Enter default max message width").setValue(this.plugin.settings.defaultMessageMaxWidth).onChange((value) => __async(this, null, function* () {
|
||||
this.plugin.settings.defaultMessageMaxWidth = value;
|
||||
yield this.plugin.saveSettings();
|
||||
})));
|
||||
new import_obsidian.Setting(containerEl).setName("Default max comment width").setDesc("Default max comment width in all dialogues.").addText((text) => text.setPlaceholder("Enter default max comment width").setValue(this.plugin.settings.defaultCommentMaxWidth).onChange((value) => __async(this, null, function* () {
|
||||
this.plugin.settings.defaultCommentMaxWidth = value;
|
||||
yield this.plugin.saveSettings();
|
||||
})));
|
||||
}
|
||||
};
|
||||
|
||||
// src/main.ts
|
||||
var DialoguePlugin = class extends import_obsidian2.Plugin {
|
||||
onload() {
|
||||
return __async(this, null, function* () {
|
||||
yield this.loadSettings();
|
||||
this.registerMarkdownCodeBlockProcessor(`dialogue`, (src, el, ctx) => {
|
||||
new DialogueRenderer(src, el, this.settings);
|
||||
});
|
||||
this.addSettingTab(new DialogueSettingTab(this.app, this));
|
||||
});
|
||||
}
|
||||
loadSettings() {
|
||||
return __async(this, null, function* () {
|
||||
this.settings = Object.assign({}, DEFAULT_SETTINGS, yield this.loadData());
|
||||
});
|
||||
}
|
||||
saveSettings() {
|
||||
return __async(this, null, function* () {
|
||||
yield this.saveData(this.settings);
|
||||
});
|
||||
}
|
||||
};
|
||||
@ -0,0 +1,10 @@
|
||||
{
|
||||
"id": "obsidian-dialogue-plugin",
|
||||
"name": "Dialogue",
|
||||
"version": "1.0.2",
|
||||
"minAppVersion": "0.12.0",
|
||||
"description": "Create dialogues in Markdown.",
|
||||
"author": "Jakub Holub",
|
||||
"authorUrl": "https://github.com/holubj",
|
||||
"isDesktopOnly": false
|
||||
}
|
||||
@ -0,0 +1,58 @@
|
||||
.dialogue-plugin-wrapper {
|
||||
margin-bottom: 20px;
|
||||
}
|
||||
|
||||
.dialogue-plugin-block-wrapper {
|
||||
display: flex;
|
||||
margin: 10px 0;
|
||||
}
|
||||
|
||||
.dialogue-plugin-message-wrapper-left {
|
||||
justify-content: start;
|
||||
}
|
||||
|
||||
.dialogue-plugin-message-wrapper-right {
|
||||
justify-content: flex-end;
|
||||
}
|
||||
|
||||
.dialogue-plugin-message {
|
||||
overflow: hidden;
|
||||
max-width: 60%;
|
||||
background-color: var(--background-secondary);
|
||||
}
|
||||
|
||||
.dialogue-plugin-message-title {
|
||||
padding: 5px 10px;
|
||||
font-weight: bold;
|
||||
background-color: rgba(0, 0, 0, 0.3);
|
||||
}
|
||||
|
||||
.dialogue-plugin-message-content {
|
||||
padding: 5px 10px;
|
||||
}
|
||||
|
||||
.dialogue-plugin-delimiter-wrapper {
|
||||
justify-content: center;
|
||||
}
|
||||
|
||||
.dialogue-plugin-delimiter {
|
||||
margin: 20px 0;
|
||||
}
|
||||
|
||||
.dialogue-plugin-delimiter-dot {
|
||||
width: 10px;
|
||||
height: 10px;
|
||||
margin: 0 3px;
|
||||
display: inline-block;
|
||||
border-radius: 50%;
|
||||
background-color: var(--background-secondary);
|
||||
}
|
||||
|
||||
.dialogue-plugin-comment-wrapper {
|
||||
justify-content: center;
|
||||
}
|
||||
|
||||
.dialogue-plugin-comment {
|
||||
margin: 20px 0;
|
||||
text-align: center;
|
||||
}
|
||||
File diff suppressed because one or more lines are too long
File diff suppressed because one or more lines are too long
File diff suppressed because one or more lines are too long
@ -1,18 +1 @@
|
||||
{
|
||||
"minimal-style@@red@@dark": "#D61515",
|
||||
"minimal-style@@orange@@light": "#FAAA26",
|
||||
"minimal-style@@orange@@dark": "#FAAA26",
|
||||
"minimal-style@@red@@light": "#D61515",
|
||||
"minimal-style@@yellow@@light": "#FDFF08",
|
||||
"minimal-style@@yellow@@dark": "#FDFF08",
|
||||
"minimal-style@@green@@light": "#16F232",
|
||||
"minimal-style@@green@@dark": "#16F232",
|
||||
"minimal-style@@cyan@@light": "#0BECDE",
|
||||
"minimal-style@@cyan@@dark": "#0BECDE",
|
||||
"minimal-style@@blue@@light": "#0F37F2",
|
||||
"minimal-style@@blue@@dark": "#0F37F2",
|
||||
"minimal-style@@purple@@light": "#950ACE",
|
||||
"minimal-style@@purple@@dark": "#950ACE",
|
||||
"minimal-style@@pink@@light": "#EE10C7",
|
||||
"minimal-style@@pink@@dark": "#EE10C7"
|
||||
}
|
||||
{}
|
||||
File diff suppressed because one or more lines are too long
File diff suppressed because one or more lines are too long
File diff suppressed because one or more lines are too long
@ -0,0 +1,7 @@
|
||||
{
|
||||
"name": "AnuPpuccin",
|
||||
"version": "1.1.4",
|
||||
"minAppVersion": "0.16.0",
|
||||
"author": "Anubis",
|
||||
"authorUrl": "https://github.com/AnubisNekhet"
|
||||
}
|
||||
File diff suppressed because it is too large
Load Diff
@ -0,0 +1,6 @@
|
||||
{
|
||||
"name": "Atom",
|
||||
"version": "0.0.0",
|
||||
"minAppVersion": "0.16.0",
|
||||
"author": "kognise"
|
||||
}
|
||||
@ -0,0 +1,472 @@
|
||||
.theme-dark {
|
||||
--background-primary: #272b34;
|
||||
--background-primary-alt: #20242b;
|
||||
--background-secondary: #20242b;
|
||||
--background-secondary-alt: #1a1e24;
|
||||
--background-accent: #000;
|
||||
--background-modifier-border: #424958;
|
||||
--background-modifier-form-field: rgba(0, 0, 0, 0.3);
|
||||
--background-modifier-form-field-highlighted: rgba(0, 0, 0, 0.22);
|
||||
--background-modifier-box-shadow: rgba(0, 0, 0, 0.3);
|
||||
--background-modifier-success: #539126;
|
||||
--background-modifier-error: #3d0000;
|
||||
--background-modifier-error-rgb: 61, 0, 0;
|
||||
--background-modifier-error-hover: #470000;
|
||||
--background-modifier-cover: rgba(0, 0, 0, 0.6);
|
||||
--text-accent: #61afef;
|
||||
--text-accent-hover: #69bafd;
|
||||
--text-normal: #dcddde;
|
||||
--text-muted: #888;
|
||||
--text-faint: rgb(81, 86, 99);
|
||||
--text-error: #e16d76;
|
||||
--text-error-hover: #c9626a;
|
||||
--text-highlight-bg: rgba(255, 255, 0, 0.4);
|
||||
--text-selection: rgba(0, 122, 255, 0.2);
|
||||
--text-on-accent: #dcddde;
|
||||
--interactive-normal: #20242b;
|
||||
--interactive-hover: #353b47;
|
||||
--interactive-accent: #4c78cc;
|
||||
--interactive-accent-rgb: 76, 120, 204;
|
||||
--interactive-accent-hover: #5082df;
|
||||
--scrollbar-active-thumb-bg: rgba(255, 255, 255, 0.2);
|
||||
--scrollbar-bg: rgba(255, 255, 255, 0.05);
|
||||
--scrollbar-thumb-bg: rgba(255, 255, 255, 0.1);
|
||||
--panel-border-color: #18191e;
|
||||
--gray-1: #5C6370;
|
||||
--gray-2: #abb2bf;
|
||||
--red: #e06c75;
|
||||
--orange: #d19a66;
|
||||
--green: #98c379;
|
||||
--aqua: #56b6c2;
|
||||
--purple: #c678dd;
|
||||
--blue: #61afef;
|
||||
--yellow: #e5c07b;
|
||||
}
|
||||
|
||||
.theme-light {
|
||||
--background-primary: #fafafa;
|
||||
--background-primary-alt: #eaeaeb;
|
||||
--background-secondary: #eaeaeb;
|
||||
--background-secondary-alt: #dbdbdc;
|
||||
--background-accent: #fff;
|
||||
--background-modifier-border: #dbdbdc;
|
||||
--background-modifier-form-field: #fff;
|
||||
--background-modifier-form-field-highlighted: #fff;
|
||||
--background-modifier-box-shadow: rgba(0, 0, 0, 0.1);
|
||||
--background-modifier-success: #A4E7C3;
|
||||
--background-modifier-error: #e68787;
|
||||
--background-modifier-error-rgb: 230, 135, 135;
|
||||
--background-modifier-error-hover: #FF9494;
|
||||
--background-modifier-cover: rgba(0, 0, 0, 0.8);
|
||||
--text-accent: #1592ff;
|
||||
--text-accent-hover: #2d9dff;
|
||||
--text-normal: #383a42;
|
||||
--text-muted: #8e8e90;
|
||||
--text-faint: #999999;
|
||||
--text-error: #e75545;
|
||||
--text-error-hover: #f86959;
|
||||
--text-highlight-bg: rgba(255, 255, 0, 0.4);
|
||||
--text-selection: rgba(0, 122, 255, 0.15);
|
||||
--text-on-accent: #f2f2f2;
|
||||
--interactive-normal: #eaeaeb;
|
||||
--interactive-hover: #dbdbdc;
|
||||
--interactive-accent-rgb: 21, 146, 255;
|
||||
--interactive-accent: #5871ef;
|
||||
--interactive-accent-hover: #445bd1;
|
||||
--scrollbar-active-thumb-bg: rgba(0, 0, 0, 0.2);
|
||||
--scrollbar-bg: rgba(0, 0, 0, 0.05);
|
||||
--scrollbar-thumb-bg: rgba(0, 0, 0, 0.1);
|
||||
--panel-border-color: #dbdbdc;
|
||||
--gray-1: #383a42;
|
||||
--gray-2: #383a42;
|
||||
--red: #e75545;
|
||||
--green: #4ea24c;
|
||||
--blue: #3d74f6;
|
||||
--purple: #a625a4;
|
||||
--aqua: #0084bc;
|
||||
--yellow: #e35649;
|
||||
--orange: #986800;
|
||||
}
|
||||
|
||||
body {
|
||||
-webkit-font-smoothing: auto;
|
||||
}
|
||||
|
||||
.titlebar {
|
||||
background-color: var(--background-secondary-alt);
|
||||
}
|
||||
|
||||
.titlebar-inner {
|
||||
color: var(--text-normal);
|
||||
}
|
||||
|
||||
.tooltip {
|
||||
background-color: var(--background-secondary-alt);
|
||||
color: var(--text-muted);
|
||||
}
|
||||
|
||||
.tooltip:not(.mod-right):not(.mod-left):not(.mod-top) .tooltip-arrow {
|
||||
border-bottom-color: var(--background-secondary-alt) !important;
|
||||
}
|
||||
|
||||
.mod-right .tooltip-arrow {
|
||||
border-right-color: var(--background-secondary-alt) !important;
|
||||
}
|
||||
|
||||
.mod-left .tooltip-arrow {
|
||||
border-left-color: var(--background-secondary-alt) !important;
|
||||
}
|
||||
|
||||
.mod-top .tooltip-arrow {
|
||||
border-top-color: var(--background-secondary-alt) !important;
|
||||
}
|
||||
|
||||
.dropdown {
|
||||
cursor: pointer;
|
||||
background-image: url(data:image/svg+xml;charset=US-ASCII,%3Csvg%20xmlns%3D%22http%3A%2F%2Fwww.w3.org%2F2000%2Fsvg%22%20width%3D%22292.4%22%20height%3D%22292.4%22%3E%3Cpath%20fill%3D%22%234c78cc%22%20d%3D%22M287%2069.4a17.6%2017.6%200%200%200-13-5.4H18.4c-5%200-9.3%201.8-12.9%205.4A17.6%2017.6%200%200%200%200%2082.2c0%205%201.8%209.3%205.4%2012.9l128%20127.9c3.6%203.6%207.8%205.4%2012.8%205.4s9.2-1.8%2012.8-5.4L287%2095c3.5-3.5%205.4-7.8%205.4-12.8%200-5-1.9-9.2-5.5-12.8z%22%2F%3E%3C%2Fsvg%3E);
|
||||
}
|
||||
|
||||
.dropdown:hover {
|
||||
background-color: var(--background-modifier-form-field);
|
||||
}
|
||||
|
||||
.search-result-file-title {
|
||||
color: var(--blue);
|
||||
}
|
||||
|
||||
li {
|
||||
padding-top: 0.5px;
|
||||
padding-bottom: 0.5px;
|
||||
}
|
||||
|
||||
a.tag, a.tag:hover {
|
||||
color: var(--yellow);
|
||||
background-color: var(--background-primary-alt);
|
||||
padding: 2px 4px;
|
||||
border-radius: 4px;
|
||||
}
|
||||
|
||||
.markdown-preview-view .task-list-item-checkbox {
|
||||
-webkit-appearance: none;
|
||||
box-sizing: border-box;
|
||||
border: 1px solid var(--text-muted);
|
||||
border-radius: 2px;
|
||||
position: relative;
|
||||
width: 1.3em;
|
||||
height: 1.3em;
|
||||
margin: 0;
|
||||
filter: none;
|
||||
outline: none;
|
||||
margin-right: 4px;
|
||||
margin-bottom: 2px;
|
||||
cursor: pointer;
|
||||
vertical-align: baseline;
|
||||
}
|
||||
|
||||
.markdown-preview-view .task-list-item-checkbox:checked {
|
||||
border: none;
|
||||
background-color: var(--interactive-accent);
|
||||
}
|
||||
|
||||
.markdown-preview-view .task-list-item-checkbox:checked::before {
|
||||
content: ' ';
|
||||
position: absolute;
|
||||
background-color: white;
|
||||
left: 2px;
|
||||
top: 2px;
|
||||
right: 2px;
|
||||
bottom: 2px;
|
||||
-webkit-mask-image: url('data:image/svg+xml,%3Csvg xmlns=\'http://www.w3.org/2000/svg\' viewBox=\'0 0 14 14\'%3E%3Cpolygon points=\'5.5 11.9993304 14 3.49933039 12.5 2 5.5 8.99933039 1.5 4.9968652 0 6.49933039\'%3E%3C/polygon%3E%3C/svg%3E');
|
||||
}
|
||||
|
||||
.markdown-preview-view .task-list-item.is-checked a {
|
||||
filter: saturate(0.8) brightness(0.7);
|
||||
}
|
||||
|
||||
.cm-formatting-task {
|
||||
font-family: var(--font-monospace);
|
||||
}
|
||||
|
||||
.nav-file, .nav-folder {
|
||||
padding: 1px 2px;
|
||||
}
|
||||
|
||||
.nav-file-title, .nav-folder-title {
|
||||
width: 100%;
|
||||
cursor: default;
|
||||
display: flex;
|
||||
align-items: baseline;
|
||||
flex-direction: row;
|
||||
--text-normal: var(--text-muted);
|
||||
}
|
||||
|
||||
body:not(.is-grabbing) .nav-file .nav-file-title:hover:not(.is-active), body:not(.is-grabbing) .nav-folder .nav-folder-title:hover:not(.is-active) {
|
||||
--background-secondary-alt: transparent;
|
||||
}
|
||||
|
||||
.nav-file .is-active {
|
||||
--background-secondary-alt: var(--interactive-accent);
|
||||
--text-normal: #ffffff;
|
||||
}
|
||||
|
||||
.nav-file-title-content, .nav-folder-title-content {
|
||||
text-indent: 0;
|
||||
white-space: nowrap;
|
||||
text-overflow: ellipsis;
|
||||
overflow: hidden;
|
||||
display: block;
|
||||
}
|
||||
|
||||
.markdown-preview-view.is-readable-line-width .markdown-preview-section, .markdown-source-view.is-readable-line-width .CodeMirror {
|
||||
max-width: 900px !important;
|
||||
line-height: 26px;
|
||||
}
|
||||
|
||||
blockquote {
|
||||
margin: 20px 0;
|
||||
border-radius: 4px !important;
|
||||
}
|
||||
|
||||
body {
|
||||
--font-monospace: 'Fira Code', 'Source Code Pro', monospace;
|
||||
}
|
||||
|
||||
mjx-container[jax='CHTML'] {
|
||||
text-align: left;
|
||||
outline: none;
|
||||
}
|
||||
|
||||
.math-block {
|
||||
font-size: 1.25em;
|
||||
}
|
||||
|
||||
.cm-s-obsidian pre.HyperMD-codeblock, .cm-s-obsidian span.cm-inline-code, .cm-s-obsidian span.cm-math:not(.cm-formatting-math-begin):not(.cm-formatting-math-end), .markdown-preview-view code {
|
||||
/* fix `` tag color */
|
||||
color: #98c379;
|
||||
}
|
||||
|
||||
.cm-s-obsidian span.cm-inline-code, .cm-s-obsidian span.cm-math, .cm-s-obsidian span.hmd-fold-math-placeholder {
|
||||
/* fix tag size */
|
||||
font-weight: 100;
|
||||
font-style: normal;
|
||||
}
|
||||
|
||||
.markdown-preview-view code {
|
||||
vertical-align: 0;
|
||||
word-break: break-word;
|
||||
}
|
||||
|
||||
.markdown-preview-section:not(:first-child) h1, .markdown-preview-section:not(:first-child) h2, .markdown-preview-section:not(:first-child) h3, .markdown-preview-section:not(:first-child) h4, .markdown-preview-section:not(:first-child) h5, .markdown-preview-section:not(:first-child) h6 {
|
||||
margin-top: 40px !important;
|
||||
}
|
||||
|
||||
.markdown-preview-section h1, .markdown-preview-section h2, .markdown-preview-section h3, .markdown-preview-section h4, .markdown-preview-section h5, .markdown-preview-section h6 {
|
||||
line-height: 1.2;
|
||||
}
|
||||
|
||||
h1, h2, h3, h4, h5, h6, strong, b, .view-header-title {
|
||||
font-weight: 600;
|
||||
}
|
||||
|
||||
.workspace>.workspace-split>.workspace-leaf:first-of-type:last-of-type .view-header {
|
||||
border: none;
|
||||
}
|
||||
|
||||
.status-bar, .side-dock.mod-right, .side-dock.mod-left {
|
||||
border-color: var(--panel-border-color);
|
||||
border-width: 1px;
|
||||
}
|
||||
|
||||
.status-bar {
|
||||
--bar-vertical-padding: 4px;
|
||||
--bar-height: calc(22px + (var(--bar-vertical-padding) * 2));
|
||||
line-height: 20px;
|
||||
padding: 0 20px;
|
||||
height: var(--bar-height);
|
||||
max-height: var(--bar-height);
|
||||
min-height: var(--bar-height);
|
||||
overflow: hidden;
|
||||
}
|
||||
|
||||
.status-bar-item {
|
||||
margin: auto 0;
|
||||
}
|
||||
|
||||
.status-bar-item>* {
|
||||
padding-top: var(--bar-vertical-padding) !important;
|
||||
padding-bottom: var(--bar-vertical-padding) !important;
|
||||
}
|
||||
|
||||
.side-dock-plugin-panel-inner {
|
||||
padding-left: 6px;
|
||||
}
|
||||
|
||||
a, .markdown-preview-view .internal-link {
|
||||
text-decoration: none;
|
||||
}
|
||||
|
||||
a:hover, .markdown-preview-view .internal-link:hover {
|
||||
text-decoration: underline;
|
||||
}
|
||||
|
||||
.theme-dark :not(pre)>code[class*='language-'], .theme-dark pre[class*='language-'] {
|
||||
background: var(--background-primary-alt);
|
||||
}
|
||||
|
||||
.theme-light :not(pre)>code[class*='language-'], .theme-light pre[class*='language-'] {
|
||||
background: var(--background-primary);
|
||||
box-shadow: inset 0 0 0 1px var(--background-primary-alt);
|
||||
border-radius: 4px;
|
||||
}
|
||||
|
||||
.markdown-embed:not(.hover-popover .markdown-embed), .file-embed {
|
||||
margin: 0;
|
||||
border-radius: 4px;
|
||||
margin: 0 !important;
|
||||
margin-inline-start: 30px !important;
|
||||
margin-inline-end: 30px !important;
|
||||
}
|
||||
|
||||
.markdown-embed {
|
||||
border: 1px solid var(--background-modifier-border);
|
||||
border-left-width: 5px;
|
||||
}
|
||||
|
||||
.markdown-embed .markdown-preview-view {
|
||||
padding: 0 20px;
|
||||
}
|
||||
|
||||
.markdown-embed-link, .file-embed-link {
|
||||
left: 8px;
|
||||
right: unset;
|
||||
}
|
||||
|
||||
.theme-light .token.operator, .theme-light .token.entity, .theme-light .token.url, .theme-light .language-css .token.string, .theme-light .style .token.string {
|
||||
background: transparent;
|
||||
}
|
||||
|
||||
/* Source: https://github.com/AGMStudio/prism-theme-one-dark */
|
||||
|
||||
code[class*='language-'], pre[class*='language-'] {
|
||||
text-align: left !important;
|
||||
white-space: pre !important;
|
||||
word-spacing: normal !important;
|
||||
word-break: normal !important;
|
||||
word-wrap: normal !important;
|
||||
line-height: 1.5 !important;
|
||||
-moz-tab-size: 4 !important;
|
||||
-o-tab-size: 4 !important;
|
||||
tab-size: 4 !important;
|
||||
-webkit-hyphens: none !important;
|
||||
-moz-hyphens: none !important;
|
||||
-ms-hyphens: none !important;
|
||||
hyphens: none !important;
|
||||
}
|
||||
|
||||
/* Code blocks */
|
||||
|
||||
pre[class*='language-'] {
|
||||
padding: 1em !important;
|
||||
margin: .5em 0 !important;
|
||||
overflow: auto !important;
|
||||
}
|
||||
|
||||
/* Inline code */
|
||||
|
||||
:not(pre)>code[class*='language-'] {
|
||||
padding: .1em !important;
|
||||
border-radius: .3em !important;
|
||||
white-space: normal !important;
|
||||
}
|
||||
|
||||
.token.comment, .token.prolog, .token.doctype, .token.cdata {
|
||||
color: var(--gray-1) !important;
|
||||
}
|
||||
|
||||
.token.punctuation {
|
||||
color: var(--gray-2) !important;
|
||||
}
|
||||
|
||||
.token.selector, .token.tag {
|
||||
color: var(--red) !important;
|
||||
}
|
||||
|
||||
.token.property, .token.boolean, .token.number, .token.constant, .token.symbol, .token.attr-name, .token.deleted {
|
||||
color: var(--orange) !important;
|
||||
}
|
||||
|
||||
.token.string, .token.char, .token.attr-value, .token.builtin, .token.inserted {
|
||||
color: var(--green) !important;
|
||||
}
|
||||
|
||||
.token.operator, .token.entity, .token.url, .language-css .token.string, .style .token.string {
|
||||
color: var(--aqua) !important;
|
||||
}
|
||||
|
||||
.token.atrule, .token.keyword {
|
||||
color: var(--purple) !important;
|
||||
}
|
||||
|
||||
.token.function, .token.macro.property {
|
||||
color: var(--blue) !important;
|
||||
}
|
||||
|
||||
.token.class-name {
|
||||
color: var(--yellow) !important;
|
||||
}
|
||||
|
||||
.token.regex, .token.important, .token.variable {
|
||||
color: var(--purple) !important;
|
||||
}
|
||||
|
||||
.token.important, .token.bold {
|
||||
font-weight: bold !important;
|
||||
}
|
||||
|
||||
.token.italic {
|
||||
font-style: italic !important;
|
||||
}
|
||||
|
||||
.token.entity {
|
||||
cursor: help !important;
|
||||
}
|
||||
|
||||
pre.line-numbers {
|
||||
position: relative !important;
|
||||
padding-left: 3.8em !important;
|
||||
counter-reset: linenumber !important;
|
||||
}
|
||||
|
||||
pre.line-numbers>code {
|
||||
position: relative !important;
|
||||
}
|
||||
|
||||
.line-numbers .line-numbers-rows {
|
||||
position: absolute !important;
|
||||
pointer-events: none !important;
|
||||
top: 0 !important;
|
||||
font-size: 100% !important;
|
||||
left: -3.8em !important;
|
||||
width: 3em !important;
|
||||
/* works for line-numbers below 1000 lines */
|
||||
letter-spacing: -1px !important;
|
||||
border-right: 0 !important;
|
||||
-webkit-user-select: none !important;
|
||||
-moz-user-select: none !important;
|
||||
-ms-user-select: none !important;
|
||||
user-select: none !important;
|
||||
}
|
||||
|
||||
.line-numbers-rows>span {
|
||||
pointer-events: none !important;
|
||||
display: block !important;
|
||||
counter-increment: linenumber !important;
|
||||
}
|
||||
|
||||
.line-numbers-rows>span:before {
|
||||
content: counter(linenumber) !important;
|
||||
color: var(--syntax-gray-1) !important;
|
||||
display: block !important;
|
||||
padding-right: 0.8em !important;
|
||||
text-align: right !important;
|
||||
}
|
||||
@ -0,0 +1,7 @@
|
||||
{
|
||||
"name": "GitHub theme",
|
||||
"version": "1.0.1",
|
||||
"minAppVersion": "1.0.0",
|
||||
"author": "@krios2146",
|
||||
"authorUrl": "https://github.com/krios2146"
|
||||
}
|
||||
@ -0,0 +1,659 @@
|
||||
body {
|
||||
/* Animations */
|
||||
--anim-duration-none: 0;
|
||||
--anim-duration-superfast: 70ms;
|
||||
--anim-duration-fast: 140ms;
|
||||
--anim-duration-moderate: 300ms;
|
||||
--anim-duration-slow: 560ms;
|
||||
--anim-motion-smooth: cubic-bezier(0.45, 0.05, 0.55, 0.95);
|
||||
--anim-motion-delay: cubic-bezier(0.65, 0.05, 0.36, 1);
|
||||
--anim-motion-jumpy: cubic-bezier(0.68, -0.55, 0.27, 1.55);
|
||||
--anim-motion-swing: cubic-bezier(0, 0.55, 0.45, 1);
|
||||
/* Blockquotes */
|
||||
--blockquote-border-thickness: 2px;
|
||||
--blockquote-border-color: var(--interactive-accent);
|
||||
--blockquote-font-style: normal;
|
||||
--blockquote-color: inherit;
|
||||
--blockquote-background-color: transparent;
|
||||
/* Bold */
|
||||
--bold-weight: var(--font-semibold);
|
||||
--bold-color: inherit;
|
||||
/* Borders */
|
||||
--border-width: 1px;
|
||||
/* Buttons */
|
||||
--button-radius: var(--input-radius);
|
||||
/* Callouts */
|
||||
--callout-border-width: 0px;
|
||||
--callout-border-opacity: 0.25;
|
||||
--callout-padding: var(--size-4-3) var(--size-4-3) var(--size-4-3) var(--size-4-6);
|
||||
--callout-radius: var(--radius-s);
|
||||
--callout-blend-mode: var(--highlight-mix-blend-mode);
|
||||
--callout-title-padding: 0;
|
||||
--callout-title-size: inherit;
|
||||
--callout-content-padding: 0;
|
||||
/* Checkboxes */
|
||||
--checkbox-radius: var(--radius-s);
|
||||
--checkbox-size: 15px;
|
||||
--checkbox-marker-color: var(--background-primary);
|
||||
--checkbox-color: var(--interactive-accent);
|
||||
--checkbox-color-hover: var(--interactive-accent-hover);
|
||||
--checkbox-border-color: var(--text-faint);
|
||||
--checkbox-border-color-hover: var(--text-muted);
|
||||
--checklist-done-decoration: line-through;
|
||||
--checklist-done-color: var(--text-muted);
|
||||
/* Code */
|
||||
--code-size: var(--font-smaller);
|
||||
--code-background: var(--background-primary-alt);
|
||||
--code-normal: var(--text-muted);
|
||||
--code-comment: var(--text-faint);
|
||||
--code-function: var(--color-orange);
|
||||
--code-important: var(--color-orange);
|
||||
--code-keyword: var(--color-red);
|
||||
--code-property: var(--color-blue);
|
||||
--code-punctuation: var(--text-muted);
|
||||
--code-string: var(--color-cyan);
|
||||
--code-tag: var(--color-red);
|
||||
--code-value: var(--color-purple);
|
||||
/* Collapse icons */
|
||||
--collapse-icon-color: var(--text-faint);
|
||||
--collapse-icon-color-collapsed: var(--text-accent);
|
||||
/* Cursor */
|
||||
--cursor: default;
|
||||
--cursor-link: pointer;
|
||||
/* Dialogs - e.g. small modals, confirmations */
|
||||
--dialog-width: 560px;
|
||||
--dialog-max-width: 80vw;
|
||||
--dialog-max-height: 85vh;
|
||||
/* Dividers — between panes */
|
||||
--divider-color: var(--background-modifier-border);
|
||||
--divider-color-hover: var(--interactive-accent);
|
||||
--divider-width: 1px;
|
||||
--divider-width-hover: 3px;
|
||||
--divider-vertical-height: calc(100% - var(--header-height));
|
||||
/* Dragging */
|
||||
--drag-ghost-background: rgba(0, 0, 0, 0.85);
|
||||
--drag-ghost-text-color: #fff;
|
||||
/* Embeds */
|
||||
--embed-background: inherit;
|
||||
--embed-border-left: 2px solid var(--interactive-accent);
|
||||
--embed-border-right: none;
|
||||
--embed-border-top: none;
|
||||
--embed-border-bottom: none;
|
||||
--embed-padding: 0 0 0 var(--size-4-6);
|
||||
--embed-font-style: inherit;
|
||||
/* Blocks */
|
||||
--embed-block-shadow-hover: 0 0 0 1px var(--background-modifier-border),
|
||||
inset 0 0 0 1px var(--background-modifier-border);
|
||||
/* File layout */
|
||||
--file-line-width: 700px;
|
||||
--file-folding-offset: 24px;
|
||||
--file-margins: var(--size-4-8);
|
||||
--file-header-font-size: var(--font-ui-small);
|
||||
--file-header-font-weight: 400;
|
||||
--file-header-border: var(--border-width) solid transparent;
|
||||
--file-header-justify: center;
|
||||
/* Relative font sizes */
|
||||
--font-smallest: 0.8em;
|
||||
--font-smaller: 0.875em;
|
||||
--font-small: 0.933em;
|
||||
/* UI font sizes */
|
||||
--font-ui-smaller: 12px;
|
||||
--font-ui-small: 13px;
|
||||
--font-ui-medium: 15px;
|
||||
--font-ui-large: 20px;
|
||||
/* Font weights */
|
||||
--font-thin: 100;
|
||||
--font-extralight: 200;
|
||||
--font-light: 300;
|
||||
--font-normal: 400;
|
||||
--font-medium: 500;
|
||||
--font-semibold: 600;
|
||||
--font-bold: 700;
|
||||
--font-extrabold: 800;
|
||||
--font-black: 900;
|
||||
/* Footnotes */
|
||||
--footnote-size: var(--font-smaller);
|
||||
/* Graphs */
|
||||
--graph-controls-width: 240px;
|
||||
--graph-text: var(--text-normal);
|
||||
--graph-line: var(--color-base-35, var(--background-modifier-border-focus));
|
||||
--graph-node: var(--text-muted);
|
||||
--graph-node-unresolved: var(--text-faint);
|
||||
--graph-node-focused: var(--text-accent);
|
||||
--graph-node-tag: var(--color-green);
|
||||
--graph-node-attachment: var(--color-yellow);
|
||||
/* Headings */
|
||||
--heading-formatting: var(--text-faint);
|
||||
--h1-color: #7ee787;
|
||||
--h2-color: #7ee787;
|
||||
--h3-color: #7ee787;
|
||||
--h4-color: #7ee787;
|
||||
--h5-color: #7ee787;
|
||||
--h6-color: #7ee787;
|
||||
--h1-font: inherit;
|
||||
--h2-font: inherit;
|
||||
--h3-font: inherit;
|
||||
--h4-font: inherit;
|
||||
--h5-font: inherit;
|
||||
--h6-font: inherit;
|
||||
--h1-line-height: 1.2;
|
||||
--h2-line-height: 1.2;
|
||||
--h3-line-height: 1.3;
|
||||
--h4-line-height: 1.4;
|
||||
--h5-line-height: var(--line-height-normal);
|
||||
--h6-line-height: var(--line-height-normal);
|
||||
--h1-size: 2em;
|
||||
--h2-size: 1.6em;
|
||||
--h3-size: 1.37em;
|
||||
--h4-size: 1.25em;
|
||||
--h5-size: 1.12em;
|
||||
--h6-size: 1.12em;
|
||||
--h1-style: normal;
|
||||
--h2-style: normal;
|
||||
--h3-style: normal;
|
||||
--h4-style: normal;
|
||||
--h5-style: normal;
|
||||
--h6-style: normal;
|
||||
--h1-variant: normal;
|
||||
--h2-variant: normal;
|
||||
--h3-variant: normal;
|
||||
--h4-variant: normal;
|
||||
--h5-variant: normal;
|
||||
--h6-variant: normal;
|
||||
--h1-weight: 700;
|
||||
--h2-weight: 600;
|
||||
--h3-weight: 600;
|
||||
--h4-weight: 600;
|
||||
--h5-weight: 600;
|
||||
--h6-weight: 600;
|
||||
/* View header */
|
||||
--header-height: 40px;
|
||||
/* Horizontal rules */
|
||||
--hr-color: var(--background-modifier-border);
|
||||
--hr-thickness: 2px;
|
||||
/* Icons */
|
||||
--icon-size: var(--icon-m);
|
||||
--icon-stroke: var(--icon-m-stroke-width);
|
||||
--icon-xs: 14px;
|
||||
--icon-s: 16px;
|
||||
--icon-m: 18px;
|
||||
--icon-l: 18px;
|
||||
--icon-xs-stroke-width: 2px;
|
||||
--icon-s-stroke-width: 2px;
|
||||
--icon-m-stroke-width: 1.75px;
|
||||
--icon-l-stroke-width: 1.75px;
|
||||
--icon-color: var(--text-muted);
|
||||
--icon-color-hover: var(--text-muted);
|
||||
--icon-color-active: var(--text-accent);
|
||||
--icon-color-focused: var(--text-normal);
|
||||
--icon-opacity: 0.85;
|
||||
--icon-opacity-hover: 1;
|
||||
--icon-opacity-active: 1;
|
||||
--clickable-icon-radius: var(--radius-s);
|
||||
/* Indentation guide */
|
||||
--indentation-guide-width: 1px;
|
||||
--indentation-guide-color: rgba(var(--mono-rgb-100), 0.12);
|
||||
--indentation-guide-color-active: rgba(var(--mono-rgb-100), 0.3);
|
||||
/* Inline title */
|
||||
--inline-title-color: var(--h1-color);
|
||||
--inline-title-font: var(--h1-font);
|
||||
--inline-title-line-height: var(--h1-line-height);
|
||||
--inline-title-size: var(--h1-size);
|
||||
--inline-title-style: var(--h1-style);
|
||||
--inline-title-variant: var(--h1-variant);
|
||||
--inline-title-weight: var(--h1-weight);
|
||||
/* Inputs */
|
||||
--input-height: 30px;
|
||||
--input-radius: 5px;
|
||||
--input-font-weight: var(--font-normal);
|
||||
--input-border-width: 1px;
|
||||
/* Italic */
|
||||
--italic-color: inherit;
|
||||
/* Z-index */
|
||||
--layer-cover: 5;
|
||||
--layer-sidedock: 10;
|
||||
--layer-status-bar: 15;
|
||||
--layer-popover: 30;
|
||||
--layer-slides: 45;
|
||||
--layer-modal: 50;
|
||||
--layer-notice: 60;
|
||||
--layer-menu: 65;
|
||||
--layer-tooltip: 70;
|
||||
--layer-dragged-item: 80;
|
||||
/* Line heights */
|
||||
--line-height-normal: 1.5;
|
||||
--line-height-tight: 1.3;
|
||||
/* Links */
|
||||
--link-color: var(--text-accent);
|
||||
--link-color-hover: var(--text-accent-hover);
|
||||
--link-decoration: none;
|
||||
--link-decoration-hover: underline;
|
||||
--link-decoration-thickness: auto;
|
||||
--link-external-color: var(--text-accent);
|
||||
--link-external-color-hover: var(--text-accent-hover);
|
||||
--link-external-decoration: none;
|
||||
--link-external-decoration-hover: underline;
|
||||
--link-external-filter: none;
|
||||
--link-unresolved-color: var(--text-accent);
|
||||
--link-unresolved-opacity: 0.7;
|
||||
--link-unresolved-filter: none;
|
||||
--link-unresolved-decoration-style: solid;
|
||||
--link-unresolved-decoration-color: hsla(var(--interactive-accent-hsl), 0.3);
|
||||
/* Lists */
|
||||
--list-indent: 2em;
|
||||
--list-spacing: 0.075em;
|
||||
--list-marker-color: var(--text-faint);
|
||||
--list-marker-color-hover: var(--text-muted);
|
||||
--list-marker-color-collapsed: var(--text-accent);
|
||||
--list-bullet-border: none;
|
||||
--list-bullet-radius: 50%;
|
||||
--list-bullet-size: 5px;
|
||||
--list-bullet-transform: none;
|
||||
/* File navigator */
|
||||
--nav-item-size: var(--font-ui-small);
|
||||
--nav-item-color: var(--text-muted);
|
||||
--nav-item-color-hover: var(--text-normal);
|
||||
--nav-item-color-active: var(--text-normal);
|
||||
--nav-item-color-selected: var(--text-normal);
|
||||
--nav-item-color-highlighted: var(--text-accent-hover);
|
||||
--nav-item-background-hover: var(--background-modifier-hover);
|
||||
--nav-item-background-active: var(--background-modifier-hover);
|
||||
--nav-item-background-selected: hsla(var(--color-accent-hsl), 0.2);
|
||||
--nav-item-padding: var(--size-4-1) var(--size-4-2);
|
||||
--nav-item-weight: inherit;
|
||||
--nav-item-weight-hover: inherit;
|
||||
--nav-item-weight-active: inherit;
|
||||
--nav-item-white-space: nowrap;
|
||||
--nav-indentation-guide-width: var(--indentation-guide-width);
|
||||
--nav-indentation-guide-color: var(--indentation-guide-color);
|
||||
--nav-collapse-icon-color: var(--collapse-icon-color);
|
||||
--nav-collapse-icon-color-collapsed: var(--text-faint);
|
||||
/* Modals - e.g. settings, community themes, community plugins */
|
||||
--modal-background: var(--background-primary);
|
||||
--modal-width: 90vw;
|
||||
--modal-height: 85vh;
|
||||
--modal-max-width: 1100px;
|
||||
--modal-max-height: 1000px;
|
||||
--modal-max-width-narrow: 800px;
|
||||
--modal-border-width: var(--border-width);
|
||||
--modal-border-color: var(--color-base-30, var(--background-modifier-border-focus));
|
||||
--modal-radius: var(--radius-l);
|
||||
--modal-community-sidebar-width: 280px;
|
||||
/* Popovers - file previews */
|
||||
--popover-width: 450px;
|
||||
--popover-height: 400px;
|
||||
--popover-max-height: 70vh;
|
||||
--popover-pdf-width: 600px;
|
||||
--popover-pdf-height: 800px;
|
||||
--popover-font-size: var(--font-text-size);
|
||||
/* Prompts - e.g. quick switcher, command palette */
|
||||
--prompt-width: 700px;
|
||||
--prompt-max-width: 80vw;
|
||||
--prompt-max-height: 70vh;
|
||||
--prompt-border-width: var(--border-width);
|
||||
--prompt-border-color: var(--color-base-40, var(--background-modifier-border-focus));
|
||||
/* Radiuses */
|
||||
--radius-s: 4px;
|
||||
--radius-m: 8px;
|
||||
--radius-l: 10px;
|
||||
--radius-xl: 16px;
|
||||
/* Ribbon */
|
||||
--ribbon-background: var(--background-secondary);
|
||||
--ribbon-background-collapsed: var(--background-primary);
|
||||
--ribbon-width: 44px;
|
||||
--ribbon-padding: var(--size-4-2) var(--size-4-1) var(--size-4-3);
|
||||
/* Scrollbars */
|
||||
--scrollbar-active-thumb-bg: rgba(var(--mono-rgb-100), 0.2);
|
||||
--scrollbar-bg: rgba(var(--mono-rgb-100), 0.05);
|
||||
--scrollbar-thumb-bg: rgba(var(--mono-rgb-100), 0.1);
|
||||
/* Search */
|
||||
--search-clear-button-color: var(--text-muted);
|
||||
--search-clear-button-size: 13px;
|
||||
--search-icon-color: var(--text-muted);
|
||||
--search-icon-size: 18px;
|
||||
--search-result-background: var(--background-primary);
|
||||
/* Layout sizing - for padding and margins */
|
||||
--size-2-1: 2px;
|
||||
--size-2-2: 4px;
|
||||
--size-2-3: 6px;
|
||||
--size-4-1: 4px;
|
||||
--size-4-2: 8px;
|
||||
--size-4-3: 12px;
|
||||
--size-4-4: 16px;
|
||||
--size-4-5: 20px;
|
||||
--size-4-6: 24px;
|
||||
--size-4-8: 32px;
|
||||
--size-4-9: 36px;
|
||||
--size-4-12: 48px;
|
||||
--size-4-16: 64px;
|
||||
--size-4-18: 72px;
|
||||
/* Sidebar */
|
||||
--sidebar-markdown-font-size: calc(var(--font-text-size) * 0.9);
|
||||
--sidebar-tab-text-display: none;
|
||||
/* Sliders */
|
||||
--slider-thumb-border-width: 1px;
|
||||
--slider-thumb-border-color: var(--background-modifier-border-hover);
|
||||
--slider-thumb-height: 18px;
|
||||
--slider-thumb-width: 18px;
|
||||
--slider-thumb-y: -6px;
|
||||
--slider-thumb-radius: 50%;
|
||||
--slider-s-thumb-size: 15px;
|
||||
--slider-s-thumb-position: -5px;
|
||||
--slider-track-background: var(--background-modifier-border);
|
||||
--slider-track-height: 3px;
|
||||
/* Status bar */
|
||||
--status-bar-background: var(--background-secondary);
|
||||
--status-bar-border-color: var(--divider-color);
|
||||
--status-bar-border-width: 1px 0 0 1px;
|
||||
--status-bar-font-size: var(--font-ui-smaller);
|
||||
--status-bar-text-color: var(--text-muted);
|
||||
--status-bar-position: fixed;
|
||||
--status-bar-radius: var(--radius-m) 0 0 0;
|
||||
/* Swatch for color inputs */
|
||||
--swatch-radius: 14px;
|
||||
--swatch-height: 24px;
|
||||
--swatch-width: 24px;
|
||||
--swatch-shadow: inset 0 0 0 1px rgba(var(--mono-rgb-100), 0.15);
|
||||
/* Tabs */
|
||||
--tab-background-active: var(--background-primary);
|
||||
--tab-text-color: var(--text-faint);
|
||||
--tab-text-color-focused: var(--text-muted);
|
||||
--tab-text-color-focused-active: var(--text-normal);
|
||||
--tab-font-size: var(--font-ui-small);
|
||||
--tab-font-weight: inherit;
|
||||
--tab-container-background: var(--background-secondary);
|
||||
--tab-divider-color: var(--background-modifier-border-hover);
|
||||
--tab-outline-color: var(--divider-color);
|
||||
--tab-outline-width: 1px;
|
||||
--tab-curve: 6px;
|
||||
--tab-radius: var(--radius-s);
|
||||
--tab-radius-active: 6px 6px 0 0;
|
||||
--tab-width: 200px;
|
||||
--tab-max-width: 320px;
|
||||
/* Stacked tabs */
|
||||
--tab-stacked-pane-width: 700px;
|
||||
--tab-stacked-header-width: var(--header-height);
|
||||
--tab-stacked-font-size: var(--font-ui-small);
|
||||
--tab-stacked-font-weight: 400;
|
||||
--tab-stacked-text-align: left;
|
||||
--tab-stacked-text-transform: rotate(0deg);
|
||||
--tab-stacked-text-writing-mode: vertical-lr;
|
||||
--tab-stacked-shadow: -8px 0 8px 0 rgba(0, 0, 0, 0.05);
|
||||
/* Tables */
|
||||
--table-background: transparent;
|
||||
--table-border-width: 1px;
|
||||
--table-border-color: var(--background-modifier-border);
|
||||
--table-white-space: normal;
|
||||
--table-header-background: var(--table-background);
|
||||
--table-header-background-hover: inherit;
|
||||
--table-header-border-width: var(--table-border-width);
|
||||
--table-header-border-color: var(--table-border-color);
|
||||
--table-header-font: inherit;
|
||||
--table-header-size: var(--font-smaller);
|
||||
--table-header-weight: var(--font-normal);
|
||||
--table-header-color: var(--text-muted);
|
||||
--table-text-size: inherit;
|
||||
--table-text-color: inherit;
|
||||
--table-column-max-width: none;
|
||||
--table-column-alt-background: var(--table-background);
|
||||
--table-column-first-border-width: var(--table-border-width);
|
||||
--table-column-last-border-width: var(--table-border-width);
|
||||
--table-row-background-hover: var(--table-background);
|
||||
--table-row-alt-background: var(--table-background);
|
||||
--table-row-last-border-width: var(--table-border-width);
|
||||
/* Tags */
|
||||
--tag-size: var(--font-smaller);
|
||||
--tag-color: var(--text-accent);
|
||||
--tag-color-hover: var(--text-accent);
|
||||
--tag-decoration: none;
|
||||
--tag-decoration-hover: none;
|
||||
--tag-background: hsla(var(--interactive-accent-hsl), 0.1);
|
||||
--tag-background-hover: hsla(var(--interactive-accent-hsl), 0.2);
|
||||
--tag-border-color: hsla(var(--interactive-accent-hsl), 0.15);
|
||||
--tag-border-color-hover: hsla(var(--interactive-accent-hsl), 0.15);
|
||||
--tag-border-width: 0px;
|
||||
--tag-padding-x: 0.65em;
|
||||
--tag-padding-y: 0.25em;
|
||||
--tag-radius: 2em;
|
||||
/* Window frame */
|
||||
--titlebar-background: var(--background-secondary);
|
||||
--titlebar-background-focused: var(--background-secondary-alt);
|
||||
--titlebar-border-width: 0px;
|
||||
--titlebar-border-color: var(--background-modifier-border);
|
||||
--titlebar-text-color: var(--text-muted);
|
||||
--titlebar-text-color-focused: var(--text-normal);
|
||||
--titlebar-text-color-highlighted: var(--text-accent-hover);
|
||||
--titlebar-text-weight: var(--font-bold);
|
||||
/* Toggles */
|
||||
--toggle-border-width: 2px;
|
||||
--toggle-width: 40px;
|
||||
--toggle-radius: 18px;
|
||||
--toggle-thumb-color: white;
|
||||
--toggle-thumb-radius: 18px;
|
||||
--toggle-thumb-height: 18px;
|
||||
--toggle-thumb-width: 18px;
|
||||
--toggle-s-border-width: 2px;
|
||||
--toggle-s-width: 34px;
|
||||
--toggle-s-thumb-height: 15px;
|
||||
--toggle-s-thumb-width: 15px;
|
||||
/* Vault name */
|
||||
--vault-name-font-size: var(--font-ui-small);
|
||||
--vault-name-font-weight: var(--font-medium);
|
||||
--vault-name-color: var(--text-normal);
|
||||
/* Workspace */
|
||||
--workspace-background-translucent: rgba(var(--mono-rgb-0), 0.6);
|
||||
/* Color mappings ------------------------ */
|
||||
/* Accent HSL values */
|
||||
--accent-h: 212;
|
||||
--accent-s: 100%;
|
||||
--accent-l: 67%;
|
||||
/* Backgrounds */
|
||||
--background-primary: var(--color-base-00);
|
||||
--background-primary-alt: var(--color-base-10);
|
||||
--background-secondary: var(--color-base-20);
|
||||
--background-modifier-hover: rgba(var(--mono-rgb-100), 0.12);
|
||||
--background-modifier-active-hover: hsla(var(--interactive-accent-hsl), 0.15);
|
||||
--background-modifier-border: var(--color-base-30);
|
||||
--background-modifier-border-hover: var(--color-base-30);
|
||||
--background-modifier-border-focus: var(--color-accent);
|
||||
--background-modifier-error-rgb: var(--color-red-rgb);
|
||||
--background-modifier-error: var(--color-red);
|
||||
--background-modifier-error-hover: var(--color-red);
|
||||
--background-modifier-success-rgb: var(--color-green-rgb);
|
||||
--background-modifier-success: var(--color-green);
|
||||
--background-modifier-message: rgba(0, 0, 0, 0.9);
|
||||
/* Inputs */
|
||||
--background-modifier-form-field: var(--color-base-00);
|
||||
/* Text */
|
||||
--text-normal: var(--color-base-100);
|
||||
--text-muted: var(--color-base-70);
|
||||
--text-faint: var(--color-base-50);
|
||||
--text-on-accent: white;
|
||||
--text-error: var(--color-red);
|
||||
--text-success: var(--color-green);
|
||||
--text-selection: hsla(var(--color-accent-hsl), 0.2);
|
||||
--text-accent: var(--color-accent);
|
||||
--text-accent-hover: var(--color-accent-2);
|
||||
--interactive-normal: var(--color-base-00);
|
||||
--interactive-hover: var(--color-base-10);
|
||||
--interactive-accent-hsl: var(--color-accent-hsl);
|
||||
--interactive-accent: var(--color-accent-1);
|
||||
--interactive-accent-hover: var(--color-accent-2);
|
||||
}
|
||||
|
||||
.theme-dark {
|
||||
color-scheme: dark;
|
||||
--highlight-mix-blend-mode: lighten;
|
||||
--mono-rgb-0: 0, 0, 0;
|
||||
--mono-rgb-100: 177, 186, 196;
|
||||
--color-red-rgb: 248, 81, 73;
|
||||
--color-red: #F47067;
|
||||
--color-green-rgb: 126, 231, 135;
|
||||
--color-green: #7ee787;
|
||||
--color-orange: #FFA657;
|
||||
--color-yellow: #d29922;
|
||||
--color-cyan: #A5D6FF;
|
||||
--color-blue: #6CB6FF;
|
||||
--color-purple: #D2A8FF;
|
||||
--color-pink: #f778ba;
|
||||
--color-base-00: #0d1117;
|
||||
--color-base-10: #161b22;
|
||||
--color-base-20: #161b22;
|
||||
--color-base-25: #010409;
|
||||
--color-base-30: #30363d;
|
||||
--color-base-35: #21262d;
|
||||
--color-base-40: #30363d;
|
||||
--color-base-50: #6e7681;
|
||||
--color-base-60: #999;
|
||||
--color-base-70: #8b949e;
|
||||
--color-base-100: #c9d1d9;
|
||||
--color-accent-hsl: var(--accent-h), var(--accent-s), var(--accent-l);
|
||||
--color-accent: hsl(var(--accent-h), var(--accent-s), var(--accent-l));
|
||||
--color-accent-1: hsl(var(--accent-h), var(--accent-s), calc(var(--accent-l) - 3.8%));
|
||||
--color-accent-2: hsl(var(--accent-h), var(--accent-s), calc(var(--accent-l) + 3.8%));
|
||||
--background-modifier-form-field: var(--color-base-25);
|
||||
--background-secondary-alt: var(--color-base-25);
|
||||
--interactive-normal: var(--color-base-35);
|
||||
--interactive-hover: var(--color-base-40);
|
||||
--background-modifier-box-shadow: rgba(0, 0, 0, 0.3);
|
||||
--background-modifier-cover: rgba(10, 10, 10, 0.4);
|
||||
--text-highlight-bg: rgba(255, 208, 0, 0.4);
|
||||
--text-highlight-bg-active: rgba(255, 128, 0, 0.4);
|
||||
--text-selection: hsla(var(--interactive-accent-hsl), 0.4);
|
||||
--input-shadow: none;
|
||||
--input-shadow-hover: none;
|
||||
--shadow-s: none;
|
||||
--shadow-l: none;
|
||||
}
|
||||
.is-mobile.theme-dark {
|
||||
--color-base-00: #0d1117;
|
||||
--color-base-10: #161b22;
|
||||
--color-base-20: #161b22;
|
||||
--tag-background: hsla(var(--interactive-accent-hsl), 0.2);
|
||||
--modal-background: var(--background-secondary);
|
||||
--search-result-background: var(--background-secondary);
|
||||
--background-modifier-form-field: var(--background-modifier-border);
|
||||
--background-modifier-cover: rgba(0, 0, 0, 0.5);
|
||||
--background-modifier-hover: rgba(var(--mono-rgb-100), 0.15);
|
||||
--settings-home-background: var(--background-primary);
|
||||
}
|
||||
|
||||
/* Tables */
|
||||
.markdown-rendered th {
|
||||
color: var(--text-normal);
|
||||
font-weight: 600;
|
||||
}
|
||||
.markdown-rendered td,
|
||||
.markdown-rendered th {
|
||||
padding: var(--size-2-3) var(--size-4-3);
|
||||
}
|
||||
.markdown-rendered tbody tr:nth-child(2n) {
|
||||
background-color: var(--background-secondary);
|
||||
}
|
||||
|
||||
/* Buttons */
|
||||
button {
|
||||
border: 1px solid #f0f6fc1a;
|
||||
transition: 80ms cubic-bezier(0.33, 1, 0.68, 1);
|
||||
}
|
||||
.theme-dark .dropdown {
|
||||
border: 1px solid #f0f6fc1a;
|
||||
}
|
||||
.theme-dark .dropdown:hover {
|
||||
border: 1px solid var(--color-base-70);
|
||||
}
|
||||
button:hover {
|
||||
border: 1px solid var(--color-base-70);
|
||||
cursor: pointer;
|
||||
}
|
||||
button.mod-cta {
|
||||
background-color: #238636;
|
||||
color: var(--text-on-accent);
|
||||
}
|
||||
button.mod-cta:hover {
|
||||
border-color: #f0f6fc1a;
|
||||
background-color: #2ea043;
|
||||
}
|
||||
|
||||
|
||||
/* Kanban */
|
||||
.kanban-plugin {
|
||||
background-color: var(--background-primary);
|
||||
}
|
||||
.kanban-plugin__lane {
|
||||
background-color: var(--background-secondary-alt);
|
||||
border: 1px solid var(--color-base-35);
|
||||
}
|
||||
.kanban-plugin__lane-title {
|
||||
flex-grow: 0;
|
||||
width: fit-content;
|
||||
}
|
||||
.kanban-plugin__item-content-wrapper,
|
||||
.kanban-plugin__item-title-wrapper {
|
||||
background: var(--background-primary-alt);
|
||||
}
|
||||
.kanban-plugin__icon>svg {
|
||||
transform: rotate(90deg);
|
||||
}
|
||||
.kanban-plugin__lane-settings-button-wrapper {
|
||||
margin-left: auto;
|
||||
}
|
||||
div.kanban-plugin__lane-title-count {
|
||||
background-color: var(--color-base-35);
|
||||
border-radius: 1em;
|
||||
padding: 2px 5px;
|
||||
}
|
||||
.kanban-plugin__item button.kanban-plugin__item-prefix-button,
|
||||
.kanban-plugin__item button.kanban-plugin__item-postfix-button,
|
||||
.kanban-plugin__lane button.kanban-plugin__lane-settings-button {
|
||||
padding: 0 5px;
|
||||
height: 24px;
|
||||
}
|
||||
.kanban-plugin__item button.kanban-plugin__item-prefix-button:hover,
|
||||
.kanban-plugin__item button.kanban-plugin__item-postfix-button:hover,
|
||||
.kanban-plugin__lane button.kanban-plugin__lane-settings-button:hover {
|
||||
background-color: var(--color-base-30);
|
||||
cursor: pointer;
|
||||
}
|
||||
button.kanban-plugin__new-item-button {
|
||||
border: none;
|
||||
justify-content: flex-start;
|
||||
}
|
||||
.kanban-plugin__new-item-button:hover {
|
||||
color: var(--text-normal);
|
||||
background-color: inherit;
|
||||
}
|
||||
.kanban-plugin__lane-items {
|
||||
padding: 8px 15px;
|
||||
}
|
||||
|
||||
/* fix: input borders */
|
||||
textarea:active,
|
||||
input[type='text']:active,
|
||||
input[type='search']:active,
|
||||
input[type='email']:active,
|
||||
input[type='password']:active,
|
||||
input[type='number']:active,
|
||||
textarea:focus,
|
||||
input[type='text']:focus,
|
||||
input[type='search']:focus,
|
||||
input[type='email']:focus,
|
||||
input[type='password']:focus,
|
||||
input[type='number']:focus,
|
||||
textarea:focus-visible,
|
||||
input[type='text']:focus-visible,
|
||||
input[type='search']:focus-visible,
|
||||
input[type='email']:focus-visible,
|
||||
input[type='password']:focus-visible,
|
||||
input[type='number']:focus-visible,
|
||||
select:focus, .dropdown:focus {
|
||||
box-shadow: 0 0 0 1px var(--background-modifier-border-focus);
|
||||
}
|
||||
|
||||
/* inline code block */
|
||||
.markdown-rendered :not(pre) > code {
|
||||
background-color: #6e768166;
|
||||
padding: 0.2em 0.4em;
|
||||
border-radius: 6px;
|
||||
color: var(--color-base-100);
|
||||
}
|
||||
File diff suppressed because one or more lines are too long
@ -0,0 +1,6 @@
|
||||
{
|
||||
"name": "Primary",
|
||||
"version": "0.0.0",
|
||||
"minAppVersion": "0.16.0",
|
||||
"author": "Cecilia May"
|
||||
}
|
||||
File diff suppressed because one or more lines are too long
@ -0,0 +1,114 @@
|
||||
---
|
||||
|
||||
title: "🗒 Daily Note"
|
||||
allDay: true
|
||||
date: 2022-10-28
|
||||
Date: 2022-10-28
|
||||
DocType: Note
|
||||
Hierarchy:
|
||||
TimeStamp:
|
||||
location:
|
||||
CollapseMetaTable: true
|
||||
Sleep: 8
|
||||
Happiness: 90
|
||||
Gratefulness: 90
|
||||
Stress: 25
|
||||
FrontHeadBar: 5
|
||||
EarHeadBar: 30
|
||||
BackHeadBar: 20
|
||||
Water: 1.25
|
||||
Coffee: 4
|
||||
Steps: 15832
|
||||
Ski:
|
||||
Riding:
|
||||
Racket:
|
||||
Football:
|
||||
Swim:
|
||||
|
||||
---
|
||||
|
||||
%% Parent:: [[@Life Admin]] %%
|
||||
|
||||
---
|
||||
|
||||
[[2022-10-27|<< 🗓 Previous ]]       [[@Main Dashboard|Back]]       [[2022-10-29|🗓 Next >>]]
|
||||
|
||||
---
|
||||
|
||||
 
|
||||
|
||||
```button
|
||||
name Record today's health
|
||||
type command
|
||||
action MetaEdit: Run MetaEdit
|
||||
id EditMetaData
|
||||
```
|
||||
^button-2022-10-28Edit
|
||||
|
||||
```button
|
||||
name Save
|
||||
type command
|
||||
action Save current file
|
||||
id Save
|
||||
```
|
||||
^button-2022-10-28NSave
|
||||
|
||||
 
|
||||
|
||||
# 2022-10-28
|
||||
|
||||
 
|
||||
|
||||
> [!summary]+
|
||||
> Daily note for 2022-10-28
|
||||
|
||||
 
|
||||
|
||||
```toc
|
||||
style: number
|
||||
```
|
||||
|
||||
 
|
||||
|
||||
---
|
||||
|
||||
 
|
||||
|
||||
### 📝 Memos
|
||||
|
||||
 
|
||||
|
||||
This section does serve for quick memos.
|
||||
|
||||
 
|
||||
|
||||
|
||||
%% --- %%
|
||||
 
|
||||
|
||||
---
|
||||
|
||||
 
|
||||
|
||||
### 🗒 Notes
|
||||
|
||||
 
|
||||
|
||||
Loret ipsum
|
||||
|
||||
 
|
||||
|
||||
---
|
||||
|
||||
 
|
||||
|
||||
### :link: Linked activity
|
||||
|
||||
 
|
||||
|
||||
```dataview
|
||||
Table from [[2022-10-28]]
|
||||
```
|
||||
|
||||
 
|
||||
 
|
||||
@ -0,0 +1,115 @@
|
||||
---
|
||||
|
||||
title: "🗒 Daily Note"
|
||||
allDay: true
|
||||
date: 2022-10-29
|
||||
Date: 2022-10-29
|
||||
DocType: Note
|
||||
Hierarchy:
|
||||
TimeStamp:
|
||||
location:
|
||||
CollapseMetaTable: true
|
||||
Sleep: 8
|
||||
Happiness: 90
|
||||
Gratefulness: 90
|
||||
Stress: 25
|
||||
FrontHeadBar: 5
|
||||
EarHeadBar: 30
|
||||
BackHeadBar: 20
|
||||
Water: 2.55
|
||||
Coffee: 3
|
||||
Steps: 13757
|
||||
Ski:
|
||||
Riding:
|
||||
Racket:
|
||||
Football:
|
||||
Swim:
|
||||
|
||||
---
|
||||
|
||||
%% Parent:: [[@Life Admin]] %%
|
||||
|
||||
---
|
||||
|
||||
[[2022-10-28|<< 🗓 Previous ]]       [[@Main Dashboard|Back]]       [[2022-10-30|🗓 Next >>]]
|
||||
|
||||
---
|
||||
|
||||
 
|
||||
|
||||
```button
|
||||
name Record today's health
|
||||
type command
|
||||
action MetaEdit: Run MetaEdit
|
||||
id EditMetaData
|
||||
```
|
||||
^button-2022-10-29Edit
|
||||
|
||||
```button
|
||||
name Save
|
||||
type command
|
||||
action Save current file
|
||||
id Save
|
||||
```
|
||||
^button-2022-10-29NSave
|
||||
|
||||
 
|
||||
|
||||
# 2022-10-29
|
||||
|
||||
 
|
||||
|
||||
> [!summary]+
|
||||
> Daily note for 2022-10-29
|
||||
|
||||
 
|
||||
|
||||
```toc
|
||||
style: number
|
||||
```
|
||||
|
||||
 
|
||||
|
||||
---
|
||||
|
||||
 
|
||||
|
||||
### 📝 Memos
|
||||
|
||||
 
|
||||
|
||||
This section does serve for quick memos.
|
||||
|
||||
 
|
||||
- 19:37 [[2022-10-29|today]], [[Crispy Salmon with Bulgur]]
|
||||
|
||||
|
||||
%% --- %%
|
||||
 
|
||||
|
||||
---
|
||||
|
||||
 
|
||||
|
||||
### 🗒 Notes
|
||||
|
||||
 
|
||||
|
||||
Loret ipsum
|
||||
|
||||
 
|
||||
|
||||
---
|
||||
|
||||
 
|
||||
|
||||
### :link: Linked activity
|
||||
|
||||
 
|
||||
|
||||
```dataview
|
||||
Table from [[2022-10-29]]
|
||||
```
|
||||
|
||||
 
|
||||
 
|
||||
File diff suppressed because it is too large
Load Diff
@ -0,0 +1,94 @@
|
||||
---
|
||||
type: "movie"
|
||||
subType: null
|
||||
title: "Hail, Caesar!"
|
||||
englishTitle: "Hail, Caesar!"
|
||||
year: "2016"
|
||||
dataSource: "OMDbAPI"
|
||||
url: "https://www.imdb.com/title/tt0475290/"
|
||||
id: "tt0475290"
|
||||
genres:
|
||||
- "Comedy"
|
||||
- "Drama"
|
||||
- "Mystery"
|
||||
producer: "Ethan Coen, Joel Coen"
|
||||
duration: "106 min"
|
||||
onlineRating: 6.3
|
||||
image: "https://m.media-amazon.com/images/M/MV5BOTI1M2FlMzItY2VjYS00Y2VkLWI5OTQtMzA0MWMyNmQzZmQ0XkEyXkFqcGdeQXVyMTMxODk2OTU@._V1_SX300.jpg"
|
||||
released: true
|
||||
premiere: "05/02/2016"
|
||||
watched: true
|
||||
lastWatched: "2022/10/27"
|
||||
personalRating: 6
|
||||
tags: "mediaDB/tv/movie"
|
||||
CollapseMetaTable: true
|
||||
|
||||
---
|
||||
|
||||
Parent:: [[@Cinematheque]]
|
||||
|
||||
---
|
||||
|
||||
```dataviewjs
|
||||
dv.paragraph(`> [!${dv.current().watched ? 'SUCCESS' : 'WARNING'}] ${dv.current().watched ? 'last watched on ' + dv.current().lastWatched : 'not yet watched'}`)
|
||||
```
|
||||
|
||||
 
|
||||
|
||||
# `$= dv.current().title`
|
||||
|
||||
 
|
||||
|
||||
`$= dv.current().watched ? '**Rating**: ' + dv.current().personalRating + ' out of 10' : ''`
|
||||
|
||||
```toc
|
||||
```
|
||||
|
||||
 
|
||||
|
||||
### Details
|
||||
|
||||
 
|
||||
|
||||
**Genres**:
|
||||
`$= dv.current().genres.length === 0 ? ' - none' : dv.list(dv.current().genres)`
|
||||
|
||||
`$= !dv.current().released ? '**Not released** The movie is not yet released.' : ''`
|
||||
|
||||
 
|
||||
|
||||
```dataview
|
||||
list without id
|
||||
"<table><tbody><tr><td><a class=heading>Type</a></td>"
|
||||
+
|
||||
"<td><span style='color: var(--footnote);'>" + this.type + "</span></td></tr>"
|
||||
+
|
||||
"<tr><td><a class=heading>Online Rating</a></td>"
|
||||
+
|
||||
"<td><span style='color: var(--footnote);'>" + this.onlineRating + "</span></td></tr>"
|
||||
+
|
||||
"<tr><td><a class=heading>Duration</a></td>"
|
||||
+
|
||||
"<td><span style='color: var(--footnote);'>" + this.duration + "</span></td></tr>"
|
||||
+
|
||||
"<tr><td><a class=heading>Premiered</a></td>"
|
||||
+
|
||||
"<td><span style='color: var(--footnote);'>" + this.premiere + "</span></td></tr>"
|
||||
+
|
||||
"<tr><td><a class=heading>Producer</a></td>"
|
||||
+
|
||||
"<td><span style='color: var(--footnote);'>" + this.producer + "</span></td></tr></tbody></table>"
|
||||
FROM "03.04 Cinematheque/Hail Caesar! (2016)"
|
||||
```
|
||||
|
||||
 
|
||||
|
||||
---
|
||||
|
||||
 
|
||||
|
||||
### Poster
|
||||
|
||||
 
|
||||
|
||||
`$= '.image + ')'`
|
||||
Loading…
Reference in new issue